Revision as of 13:32, 13 March 2024 editMarbletan (talk | contribs)Extended confirmed users5,633 editsNo edit summary← Previous edit |
Latest revision as of 04:06, 22 January 2025 edit undoRaynore329 (talk | contribs)Extended confirmed users1,557 editsNo edit summaryTag: Visual edit: Switched |
(2 intermediate revisions by 2 users not shown) |
Line 10: |
Line 10: |
|
| CASNo = 19086-75-0 |
|
| CASNo = 19086-75-0 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| ChemSpiderID = 59696884 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = BA7JCC4U52 |
|
| UNII = BA7JCC4U52 |
|
| CASNoOther = |
|
|
| PubChem = 99973 |
|
| PubChem = 99973 |
|
|
| StdInChI=1S/C27H20O18/c28-2-5-14(31)23-24-20(37)12-11(27(42)45-24)9(18(35)22(39)19(12)36)8-10(26(41)44-23)7(16(33)21(38)17(8)34)6-3(25(40)43-5)1-4(29)13(30)15(6)32/h1,5,14,20,23-24,28-39H,2H2 |
|
|
| StdInChIKey = PPUHUWSVCUJGTD-UHFFFAOYSA-N |
|
| SMILES = C1=C2C(=C(C(=C1O)O)O)C3=C4C(=C(C(=C3O)O)O)C5=C6C(=C(C(=C5O)O)O)C(C(C(C(C(OC2=O)CO)O)OC4=O)OC6=O)O |
|
| SMILES = C1=C2C(=C(C(=C1O)O)O)C3=C4C(=C(C(=C3O)O)O)C5=C6C(=C(C(=C5O)O)O)C(C(C(C(C(OC2=O)CO)O)OC4=O)OC6=O)O |
|
⚫ |
}} |
|
| InChI = |
|
|
| MeSHName = |
|
⚫ |
}} |
|
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=27 | H=20 | O=18 |
|
| C=27 | H=20 | O=18 |
Line 27: |
Line 27: |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
{{Redirect|Castlin|the move in chess|Castling}} |
|
|
|
|
'''Castalin''' is an ]. It can be found in ] wood<ref>{{cite journal | doi = 10.1051/forest:2006021 }} {{webarchive|url=https://web.archive.org/web/20070712175537/http://www.afs-journal.org/index.php?option=article&access=standard&Itemid=129&url=%2Farticles%2Fforest%2Fpdf%2F2006%2F04%2Ff6043.pdf |date=2007-07-12 }}</ref> and in '']'' leaves.<ref>{{cite journal | doi = 10.1002/ptr.1214 }}</ref> |
|
'''Castalin''' is an ]. It can be found in ] wood<ref>{{cite journal | doi = 10.1051/forest:2006021 | title = Effect of species and ecological conditions on ellagitannin content in oak wood from an even-aged and mixed stand of ''Quercus robur'' L. And ''Quercus petraea'' Liebl | date = 2006 | last1 = Prida | first1 = Andrei | last2 = Boulet | first2 = Jean-Claude | last3 = Ducousso | first3 = Alexis | last4 = Nepveu | first4 = Gérard | last5 = Puech | first5 = Jean-Louis | journal = Annals of Forest Science | volume = 63 | issue = 4 | pages = 415–424 | bibcode = 2006AnFSc..63..415P }} {{webarchive|url=https://web.archive.org/web/20070712175537/http://www.afs-journal.org/index.php?option=article&access=standard&Itemid=129&url=%2Farticles%2Fforest%2Fpdf%2F2006%2F04%2Ff6043.pdf |date=2007-07-12 }}</ref> and in '']'' leaves.<ref>{{cite journal | doi = 10.1002/ptr.1214 | title = Polyphenols of ''Melaleuca quinquenervia'' leaves – pharmacological studies of grandinin | date = 2003 | last1 = Moharram | first1 = F. A. | last2 = Marzouk | first2 = M. S. | last3 = El-Toumy | first3 = S. A. A. | last4 = Ahmed | first4 = A. A. E. | last5 = Aboutabl | first5 = E. A. | journal = Phytotherapy Research | volume = 17 | issue = 7 | pages = 767–773 | pmid = 12916075 | s2cid = 45936055 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |