Revision as of 05:13, 13 January 2025 editGraeme Bartlett (talk | contribs)Administrators250,278 edits chemspider← Previous edit | Latest revision as of 05:20, 13 January 2025 edit undoGraeme Bartlett (talk | contribs)Administrators250,278 edits indexing to add the chloride | ||
(One intermediate revision by the same user not shown) | |||
Line 8: | Line 8: | ||
| OtherNames = Guibourtinidin chloride<br>3,7,4'-Trihydroxyflavylium chloride | | OtherNames = Guibourtinidin chloride<br>3,7,4'-Trihydroxyflavylium chloride | ||
|Section1={{Chembox Identifiers | |Section1={{Chembox Identifiers | ||
| index_label=ion | |||
| index1_label=chloride | |||
| CASNo = 23130-31-6 | | CASNo = 23130-31-6 | ||
| CASNo_Ref = {{Cascite| |
| CASNo_Ref = {{Cascite|correct|CAS}} | ||
| CASNo1 = 13544-54-2 | |||
⚫ | | |
||
| CASNo1_Ref = {{Cascite|changed|EPA}} | |||
⚫ | | ChemSpiderID1 = 15076754 | ||
| DTXSID1 = DTXSID80275976 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| UNII = 5K4V6C6T6B | | UNII = 5K4V6C6T6B | ||
| PubChem = 20481741 | | PubChem = 20481741 | ||
| PubChem1 = 20481740 | |||
| SMILES = C1=CC(=CC=C1C2=C(C=C3C=CC(=CC3=2)O)O)O | | SMILES = C1=CC(=CC=C1C2=C(C=C3C=CC(=CC3=2)O)O)O | ||
| |
| InChI=1S/C15H10O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-8H,(H2-,16,17,18)/p+1 | ||
| |
| InChIKey = ZGQPDIBIQDDUNF-UHFFFAOYSA-O | ||
| SMILES1 = Oc1ccc(-c2c3cc(O)ccc3cc2O)cc1. | |||
| InChI1=1S/C15H10O4.ClH/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15;/h1-8H,(H2-,16,17,18);1H | |||
| InChIKey1 = ADQYOABEIDHQIG-UHFFFAOYSA-N | |||
}} | }} | ||
|Section2={{Chembox Properties | |Section2={{Chembox Properties | ||
Line 46: | Line 55: | ||
] | ] | ||
] | |||
{{Aromatic-stub}} | {{Aromatic-stub}} |
Latest revision as of 05:20, 13 January 2025
Names | |
---|---|
IUPAC name 2-(4-hydroxyphenyl)chromenylium-3,7-diol | |
Other names
Guibourtinidin chloride 3,7,4'-Trihydroxyflavylium chloride | |
Identifiers | |
CAS Number |
|
3D model (JSmol) |
|
ChemSpider |
|
PubChem CID | |
UNII |
|
CompTox Dashboard (EPA) |
|
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C15H11O4+ Cl |
Molar mass | 255.24 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references |
Guibourtinidin is an anthocyanidin.
Tannins
Guibourtinidin forms tannins called leucoguibourtinidins or proguibourtinidins.
References
External links
This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it. |