Misplaced Pages

Ovalene: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 15:26, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit Latest revision as of 07:16, 5 December 2023 edit undoMaterialscientist (talk | contribs)Edit filter managers, Autopatrolled, Checkusers, Administrators1,994,339 edits add 
(17 intermediate revisions by 13 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 415521657
| Watchedfields = changed
| verifiedrevid = 424699386
| ImageFile = Ovalene.png | ImageFile = Ovalene.png
| ImageName = Skeletal formula | ImageAlt = Structural formula of ovalene
| ImageFile1 = Ovalene-3D-balls.png | ImageFile1 = Ovalene 3D ball.png
| ImageName1 = Ball-and-stick model | ImageAlt1 = Ball-and-stick model of the ovalene molecule
| PIN = Ovalene<ref name=iupac2013>{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = ] | date = 2014 | location = Cambridge | page = 205 | doi = 10.1039/9781849733069-FP001 | isbn = 978-0-85404-182-4}}</ref>
| IUPACName = Ovalene
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| Abbreviations = | Abbreviations =
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 190-26-1 | CASNo = 190-26-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3M1901484G
| EINECS = 205-880-1 | EINECS = 205-880-1
| PubChem = 10483367 | PubChem = 67446
| SMILES = c1cc2c3c4c1ccc5cc6c7c8c(ccc9=c8c1c(cc9)cc(c3c1c7c54)cc2)cc6 | SMILES = c1cc2c3c4c1ccc5cc6c7c8c(ccc9=c8c1c(cc9)cc(c3c1c7c54)cc2)cc6
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| InChI =
| ChemSpiderID = 60771
| RTECS =
| InChI = 1/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14H
| MeSHName =
| InChIKey = LSQODMMMSXHVCN-UHFFFAOYAN
| ChEBI =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14H
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = LSQODMMMSXHVCN-UHFFFAOYSA-N
| RTECS =
| MeSHName =
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 33091
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = | KEGG =
}}
| ATCCode_prefix =
|Section2={{Chembox Properties
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = C<sub>32</sub>H<sub>14</sub> | Formula = C<sub>32</sub>H<sub>14</sub>
| MolarMass = 398.45 g/mol | MolarMass = 398.45 g/mol
| Appearance = | Appearance =
| Density = | Density = 1.496 g/cm<sup>3</sup><ref name=str/>
| MeltingPt = | MeltingPtC = 473
| MeltingPt_ref =<ref name=str/>
| Melting_notes =
| BoilingPt = | BoilingPt =
| Boiling_notes = | BoilingPt_notes =
| Solubility = | Solubility =
| SolubleOther = | SolubleOther =
| Solvent = | Solvent =
| pKa = | pKa =
| pKb = }} | pKb =
| MagSus = -353.8·10<sup>−6</sup> cm<sup>3</sup>/mol<ref>{{cite journal|doi=10.1038/168520b0 |title=Electrical Conductivity and Magnetic Susceptibility of Ovalene |date=1951 |last1=Akamatu |first1=Hideo |last2=Inokuchi |first2=Hiroo |last3=Handa |first3=Takashi |journal=Nature |volume=168 |issue=4273 |pages=520–521 |bibcode=1951Natur.168..520A |s2cid=4172683 }}</ref>
| Section7 = {{Chembox Hazards
}}
| EUClass =
| Section3 = {{Chembox Structure
| EUIndex =
| Structure_ref =<ref name=str>{{cite journal|doi=10.1098/rspa.1953.0179 |title=The crystal and molecular structure of ovalene a quantitative X-ray investigation |journal=Proceedings of the Royal Society of London. Series A. Mathematical and Physical Sciences |date=1953 |volume=220 |issue=1141 |pages=157–170 |bibcode=1953RSPSA.220..157D |last1=Donaldson |first1=D. M. |last2=Robertson |first2=J. M. |s2cid=98584903 }}</ref>
| CrystalStruct =
| SpaceGroup = ], P2<sub>1</sub>/a
| PointGroup =
| LattConst_a = 1.947(5) nm
| LattConst_b = 0.470(1) nm
| LattConst_c = 1.012(4) nm
| LattConst_alpha =
| LattConst_beta = 105.0(3)
| LattConst_gamma =
| LattConst_ref =
| LattConst_Comment =
| UnitCellVolume =
| UnitCellFormulas = 2
| Coordination =
| MolShape =
| OrbitalHybridisation =
| Dipole =
}}
|Section7={{Chembox Hazards
| MainHazards = | MainHazards =
| NFPA-H = | NFPA-H =
| NFPA-F = | NFPA-F =
| NFPA-R = | NFPA-R =
| NFPA-O = | NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
| ExploLimits = | ExploLimits =
| PEL = }} | PEL = }}
Line 60: Line 88:


==References== ==References==
{{Reflist}}
* {{cite book | last = Fetzer | first = J. C. | title = The Chemistry and Analysis of the Large Polycyclic Aromatic Hydrocarbons | location = New York | publisher = Wiley | year = 2000 }}


==External links== ==External links==
* at ] * at ]

]


{{PAHs}} {{PAHs}}


]
]
]
]
]

Latest revision as of 07:16, 5 December 2023

Ovalene
Structural formula of ovalene
Ball-and-stick model of the ovalene molecule
Names
Preferred IUPAC name Ovalene
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
ECHA InfoCard 100.005.347 Edit this at Wikidata
EC Number
  • 205-880-1
PubChem CID
UNII
CompTox Dashboard (EPA)
InChI
  • InChI=1S/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14HKey: LSQODMMMSXHVCN-UHFFFAOYSA-N
  • InChI=1/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14HKey: LSQODMMMSXHVCN-UHFFFAOYAN
SMILES
  • c1cc2c3c4c1ccc5cc6c7c8c(ccc9=c8c1c(cc9)cc(c3c1c7c54)cc2)cc6
Properties
Chemical formula C32H14
Molar mass 398.45 g/mol
Density 1.496 g/cm
Melting point 473 °C (883 °F; 746 K)
Magnetic susceptibility (χ) -353.8·10 cm/mol
Structure
Space group monoclinic, P21/a
Lattice constant a = 1.947(5) nm, b = 0.470(1) nm, c = 1.012(4) nmα = 90°, β = 105.0(3)°, γ = 90°
Formula units (Z) 2
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Chemical compound

Ovalene is a polycyclic aromatic hydrocarbon with the formula C32H14, which consists of ten peri-fused six-membered rings. It is very similar to coronene.

Ovalene is a reddish-orange compound. It is sparingly soluble in solvents such as benzene, toluene, and dichloromethane. Its solutions have a green fluorescence under UV light.

Ovalene has been shown to form in deep-sea hydrothermal vent areas and in the hydrocracking process of petroleum refining.

References

  1. Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book). Cambridge: The Royal Society of Chemistry. 2014. p. 205. doi:10.1039/9781849733069-FP001. ISBN 978-0-85404-182-4.
  2. ^ Donaldson, D. M.; Robertson, J. M. (1953). "The crystal and molecular structure of ovalene a quantitative X-ray investigation". Proceedings of the Royal Society of London. Series A. Mathematical and Physical Sciences. 220 (1141): 157–170. Bibcode:1953RSPSA.220..157D. doi:10.1098/rspa.1953.0179. S2CID 98584903.
  3. Akamatu, Hideo; Inokuchi, Hiroo; Handa, Takashi (1951). "Electrical Conductivity and Magnetic Susceptibility of Ovalene". Nature. 168 (4273): 520–521. Bibcode:1951Natur.168..520A. doi:10.1038/168520b0. S2CID 4172683.

External links

Polycyclic aromatic hydrocarbons
2 rings
3 rings
4 rings
5 rings
6 rings
7+ rings
General classes
Category:
Ovalene: Difference between revisions Add topic