Revision as of 10:08, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 19:56, 20 December 2023 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Vinylogous carboxylic acids using HotCat |
(35 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 406237041 |
|
|
|
| Watchedfields = changed |
⚫ |
| Name = Coumaroyl-Coenzyme A |
|
|
⚫ |
| verifiedrevid = 426717604 |
⚫ |
| ImageFile = 4-Coumaroyl-CoA.svg |
|
|
⚫ |
| Name = Coumaroyl-Coenzyme A |
⚫ |
| ImageSize = 250px |
|
|
⚫ |
| ImageFile = 4-Coumaroyl-CoA.svg |
|
| IUPACName = <nowiki>S-methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3, |
|
|
⚫ |
| ImageSize = 250px |
|
3-dimethylbutanoyl]amino]propanoylamino]ethyl](E)-3-(4-hydroxyphenyl)prop-2-enethioate</nowiki> |
|
|
|
| IUPACName = 3′-''O''-Phosphonoadenosine 5′-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl dihydrogen diphosphate] |
⚫ |
| OtherNames = 4-]-]<br>p-Coumaroyl-CoA<br>4-Hydroxycinnamoyl-CoA |
|
|
|
| SystematicName = methyl (3''R'')-3-hydroxy-4-({3-sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl dihydrogen diphosphate |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = ]-]<br>p-Coumaroyl-CoA<br>4-Hydroxycinnamoyl-CoA |
⚫ |
| CASNo = 119785-99-8 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
| PubChem = 5280329 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| SMILES = CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCSC(=O)C=CC4=CC=C(C=C4)O)O |
|
|
⚫ |
| CASNo = 119785-99-8 |
⚫ |
| MeSHName = |
|
|
⚫ |
| PubChem = 6440013 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4944344 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C00223 |
|
⚫ |
| SMILES = CC(C)(COP(=O)(O)OP(=O)(O)OC1(((O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)(C(=O)NCCC(=O)NCCSC(=O)/C=C/C4=CC=C(C=C4)O)O |
|
|
| InChI = 1/C30H42N7O18P3S/c1-30(2,25(42)28(43)33-10-9-20(39)32-11-12-59-21(40)8-5-17-3-6-18(38)7-4-17)14-52-58(49,50)55-57(47,48)51-13-19-24(54-56(44,45)46)23(41)29(53-19)37-16-36-22-26(31)34-15-35-27(22)37/h3-8,15-16,19,23-25,29,38,41-42H,9-14H2,1-2H3,(H,32,39)(H,33,43)(H,47,48)(H,49,50)(H2,31,34,35)(H2,44,45,46)/b8-5+/t19-,23-,24-,25+,29-/m1/s1 |
|
|
| InChIKey = DMZOKBALNZWDKI-MATMFAIHBG |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C30H42N7O18P3S/c1-30(2,25(42)28(43)33-10-9-20(39)32-11-12-59-21(40)8-5-17-3-6-18(38)7-4-17)14-52-58(49,50)55-57(47,48)51-13-19-24(54-56(44,45)46)23(41)29(53-19)37-16-36-22-26(31)34-15-35-27(22)37/h3-8,15-16,19,23-25,29,38,41-42H,9-14H2,1-2H3,(H,32,39)(H,33,43)(H,47,48)(H,49,50)(H2,31,34,35)(H2,44,45,46)/b8-5+/t19-,23-,24-,25+,29-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = DMZOKBALNZWDKI-MATMFAIHSA-N |
|
⚫ |
| MeSHName = |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>30</sub>H<sub>42</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S |
|
| Formula = C<sub>30</sub>H<sub>42</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S |
|
| MolarMass = 913.67 g/mol |
|
| MolarMass = 913.67 g/mol |
|
|
| Appearance = |
|
| ExactMass = 913.151988 |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Coumaroyl-coenzyme A''' is the ] of ] and ]. Coumaroyl-coenzyme A is a central intermediate in the biosynthesis of myriad natural products found in plants. These products include ] (precursors to ] and ]), ], ], ]s, ], ], ], and other ]s.<ref>{{cite journal|journal=Molecular Plant|year=2010|pages=2–20|doi=10.1093/mp/ssp106|title=Phenylpropanoid Biosynthesis|author=Vogt, T.|pmid=20035037|volume=3|doi-access=free}}</ref> |
|
'''Coumaroyl-Coenzyme A''' is a chemical compound used in ] production, a key compound in the ]s and ]s biosynthesis pathways in plants. |
|
|
|
|
|
|
|
==Biosynthesis and significance== |
|
] is also synthetized via coumaroyl-coA<ref></ref>. |
|
|
|
It is generated in nature from ], which is converted by ] to trans-]. Trans-cinnamate is hydroxylated by ] to give 4-hydroxycinnamate (i.e, coumarate). Coumarate is condensed with coenzyme-A in the presence of ]: |
|
|
:ATP + 4-coumarate + CoA <math>\rightleftharpoons</math> AMP + diphosphate + 4-coumaroyl-CoA. |
|
|
|
|
|
==Enzymes using Coumaroyl-Coenzyme A== |
|
== Enzymes using Coumaroyl-Coenzyme A == |
|
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
Line 43: |
Line 58: |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Hydroxycinnamic acid}} |
|
|
|
|
|
{{DEFAULTSORT:Coumaroyl-Coa}} |
|
{{DEFAULTSORT:Coumaroyl-Coa}} |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{Aromatic-stub}} |
|
|
|
|
{{organic-compound-stub}} |
|
|
|
|
|
] |
|
|
] |
|