Revision as of 20:05, 20 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 13:51, 20 November 2023 edit undoOAbot (talk | contribs)Bots442,978 editsm Open access bot: doi updated in citation with #oabot. |
(20 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 445993063 |
|
| verifiedrevid = 451559556 |
|
| IUPAC_name = 2-(2-oxopyrrolidin-1-yl)-N'-acetohydrazide |
|
| IUPAC_name = 2-(2-oxopyrrolidin-1-yl)-N'-acetohydrazide |
|
| image = Dupracetam_structure.png |
|
| image = Dupracetam.svg |
|
| width = 220 |
|
| width = 220 |
|
|
|
|
Line 9: |
Line 11: |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = Unscheduled |
|
| legal_status = Unscheduled |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 59776-90-8 |
|
| CAS_number = 59776-90-8 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| PubChem = 68793 |
|
| PubChem = 68793 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2104359 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = BVM2UGN450 |
|
| UNII = BVM2UGN450 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 62033 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H18N4O4/c17-9(7-15-5-1-3-11(15)19)13-14-10(18)8-16-6-2-4-12(16)20/h1-8H2,(H,13,17)(H,14,18) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YPUPYVWSTBYCBY-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=18 | N=4 | O=4 |
|
| C=12 | H=18 | N=4 | O=4 |
|
| molecular_weight = 282.296 g/mol |
|
|
| smiles = C1CC(=O)N(C1)CC(=O)NNC(=O)CN2CCCC2=O |
|
| smiles = C1CC(=O)N(C1)CC(=O)NNC(=O)CN2CCCC2=O |
|
}} |
|
}} |
|
|
|
|
|
'''Dupracetam''' is a ] drug from the ] family.<ref name="pmid7294979">{{cite journal |author=Dell HD, Jacobi H, Kamp R, Kurz J, Wünsche C |title= |language=German |journal=Archiv Der Pharmazie |volume=314 |issue=8 |pages=697–702 |year=1981 |month=August |pmid=7294979 |doi= |url=}}</ref><ref name="pmid2829047">{{cite journal |author=Hall ED, Von Voigtlander PF |title=Facilitatory effects of piracetam on excitability of motor nerve terminals and neuromuscular transmission |journal=Neuropharmacology |volume=26 |issue=11 |pages=1573–9 |year=1987 |month=November |pmid=2829047 |doi= 10.1016/0028-3908(87)90003-7|url=}}</ref> |
|
'''Dupracetam''' is a ] drug from the ] family.<ref name="pmid7294979">{{cite journal | vauthors = Dell HD, Jacobi H, Kamp R, Kurz J, Wünsche C | title = | language = de | journal = Archiv der Pharmazie | volume = 314 | issue = 8 | pages = 697–702 | date = August 1981 | pmid = 7294979 | doi = 10.1002/ardp.19813140808 | s2cid = 95603731 }}</ref><ref name="pmid2829047">{{cite journal | vauthors = Hall ED, Von Voigtlander PF | title = Facilitatory effects of piracetam on excitability of motor nerve terminals and neuromuscular transmission | journal = Neuropharmacology | volume = 26 | issue = 11 | pages = 1573–1579 | date = November 1987 | pmid = 2829047 | doi = 10.1016/0028-3908(87)90003-7 | s2cid = 7759558 }}</ref> |
|
|
|
|
|
|
One of its metabolites, 1-Methylhydantoin, displays renal toxicity in high doses.<ref>{{cite journal | vauthors = Yang B, Liu D, Li CZ, Liu FY, Peng YM, Jiang YS | title = 1-Methylhydantoin cytotoxicity on renal proximal tubular cells in vitro | journal = Renal Failure | volume = 29 | issue = 8 | pages = 1025–1029 | year = 2007 | pmid = 18067051 | doi = 10.1080/08860220701641272 | s2cid = 26843776 | doi-access = free }}</ref> |
|
|
|
|
|
⚫ |
== See also == |
|
|
|
⚫ |
==See also== |
|
|
* ] |
|
* ] |
|
|
|
|
Line 43: |
Line 53: |
|
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |
One of its metabolites, 1-Methylhydantoin, displays renal toxicity in high doses.