Revision as of 14:39, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 456966867 of page Omeprazole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{drugbox |
|
{{Drugbox| Verifiedfields = changed |
|
|
| verifiedrevid = 419941151 |
|
| verifiedrevid = 477001424 |
|
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| drug_name = Omeprazole |
|
|
|
| image = L-Ascorbic_acid.svg |
|
|IUPAC_name = (''RS'')-6-methoxy-2-((4-methoxy-3,5-dimethylpyridin-2-yl) methylsulfinyl)-1''H''-benzoimidazole |
|
|
| image = Omeprazole.svg |
|
| width = 200px |
|
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
|
| width2 = 200px |
|
| width=220 |
|
|
|
|
|
| image2 = Omeprazole_3d_structure.png |
|
|
|
<!--Clinical data--> |
|
| width = 220 |
|
|
|
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
|
| licence_EU = <!-- EMEA requires brand name --> |
|
|
| licence_US = <!-- FDA may use generic name --> |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = A |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = general public availability |
|
|
| routes_of_administration = oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = rapid & complete |
|
|
| protein_bound = negligible |
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
|
| excretion = renal |
|
|
|
|
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 50-81-7 |
|
|
| ATC_prefix = A |
|
|
| ATC_suffix = 11G |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 29073 |
|
|
| PubChem = 5785 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 10189562 |
|
|
| NIAID_ChemDB = 002072 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = KG60484QX9 |
|
| UNII = PQ6CK8PD0R |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00455 |
|
| KEGG = D00018 |
|
| InChI = 1/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20) |
|
|
| InChIKey = SUBDBMMJDZJVOS-UHFFFAOYAZ |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1503 |
|
| ChEMBL = 196 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
|
| C=6 | H=7 | O=6 |
|
|
| molecular_weight = 176.12 g/] |
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20) |
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SUBDBMMJDZJVOS-UHFFFAOYSA-N |
|
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
| synonyms = <small>L</small>-ascorbic acid |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| density = 1.694 |
|
| CAS_number=73590-58-6 |
|
|
|
| melting_point = 190 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 4433 |
|
| boiling_point = 553 |
|
| ATC_prefix=A02 |
|
|
| ATC_suffix=BC01 |
|
|
| ATC_supplemental= |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 7772 |
|
|
| PubChem=4594 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00338 |
|
|
| C = 17 | H = 19 | N = 3 | O = 3 | S = 1 |
|
|
| molecular_weight = 345.4 g/mol |
|
|
| smiles = O=S(c2nc1ccc(OC)cc1n2)Cc3ncc(c(OC)c3C)C |
|
|
| bioavailability= 35–76%<ref>. AstraZeneca Pharmaceuticals.</ref><ref>{{cite journal |
|
|
| last1 = Vaz-Da-Silva | first1 = M |
|
|
| last2 = Loureiro | first2 = AI |
|
|
| last3 = Nunes | first3 = T |
|
|
| last4 = Maia | first4 = J |
|
|
| last5 = Tavares | first5 = S |
|
|
| last6 = Falcão | first6 = A |
|
|
| last7 = Silveira | first7 = P |
|
|
| last8 = Almeida | first8 = L |
|
|
| last9 = Soares-Da-Silva | first9 = P |
|
|
| title = Bioavailability and bioequivalence of two enteric-coated formulations of omeprazole in fasting and fed conditions |
|
|
| journal = ] |
|
|
| volume = 25 |
|
|
| issue = 6 |
|
|
| pages = 391–9 |
|
|
| year = 2005 |
|
|
| pmid = 17532679 |
|
|
| url = http://www.medscape.com/viewarticle/508018 |
|
|
| doi = 10.2165/00044011-200525060-00004 |
|
|
}}</ref> |
|
|
| protein_bound = 95% |
|
|
| metabolism = ] (], ]) |
|
|
| elimination_half-life= 1 – 1.2 hours |
|
|
| excretion = 80% ]<br>20% ] |
|
|
| pregnancy_US = C |
|
|
| pregnancy_AU = B3 |
|
|
| legal_AU = S4 |
|
|
| legal_UK = POM |
|
|
| legal_US = OTC |
|
|
| routes_of_administration= Oral, ] |
|
|
| licence_US = Omeprazole |
|
|
}} |
|
}} |