Revision as of 13:46, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,077 edits Saving copy of the {{chembox}} taken from revid 465842011 of page Toxoflavin for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{drugbox |
|
⚫ |
| verifiedrevid = 477001424 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| Watchedfields = changed |
|
|
|
| image = L-Ascorbic_acid.svg |
⚫ |
| verifiedrevid = 459508337 |
|
|
|
| width = 200px |
|
| Reference = <ref name=Merck>'']'', 11th Edition, '''9480'''</ref><ref>, at the ]</ref> |
|
|
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
|
| ImageFile = Toxoflavin.png |
|
|
| ImageSize = 180px |
|
| width2 = 200px |
|
|
|
|
| IUPACName = 1,6-Dimethylpyrimidotriazine-5,7(1''H'',6''H'')-dione |
|
|
|
<!--Clinical data--> |
|
| OtherNames = Toxoflavine; Xanthothricin; Xanthotricin |
|
|
|
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| licence_EU = <!-- EMEA requires brand name --> |
⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
| CASNo = <!-- blanked - oldvalue: 84-82-2 --> |
|
| licence_US = <!-- FDA may use generic name --> |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| ChEMBL = 578512 |
|
|
|
| pregnancy_category = A |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = general public availability |
|
|
| routes_of_administration = oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = rapid & complete |
|
|
| protein_bound = negligible |
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
|
| excretion = renal |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 50-81-7 |
|
|
| ATC_prefix = A |
|
|
| ATC_suffix = 11G |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 29073 |
|
⚫ |
| PubChem = 5785 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 10189562 |
|
|
| NIAID_ChemDB = 002072 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = PQ6CK8PD0R |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00018 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 196 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
⚫ |
| C=6 | H=7 | O=6 |
|
|
| molecular_weight = 176.12 g/] |
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C7H7N5O2/c1-11-6(13)4-5(10-7(11)14)12(2)9-3-8-4/h3H,1-2H3 |
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SLGRAIAQIAUZAQ-UHFFFAOYSA-N |
|
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
| synonyms = <small>L</small>-ascorbic acid |
⚫ |
| PubChem = 66541 |
|
|
|
| density = 1.694 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 59912 |
|
| melting_point = 190 |
|
|
| boiling_point = 553 |
|
| SMILES = O=C2\N=C1C(=N/C=N\N1C)\C(=O)N2C |
|
|
| InChI = InChI=1S/C7H7N5O2/c1-11-6(13)4-5(10-7(11)14)12(2)9-3-8-4/h3H,1-2H3 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
⚫ |
| C=7|H=7|N=5|O=2 |
|
|
| Appearance = Bright yellow solid |
|
|
| Density = |
|
|
| MeltingPt = 172–173 °C (dec.) |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| LD50 = 1.7 mg/kg (], mouse)<br>8.4 mg/kd (], mouse) |
|
|
}} |
|
|
}} |
|
}} |