Revision as of 04:40, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 477292874 of page Benzoyl_peroxide for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary |
(513 intermediate revisions by 8 users not shown) |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{drugbox |
|
|
| verifiedrevid = 477001424 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one |
|
| verifiedrevid = 476993765 |
|
|
|
| image = L-Ascorbic_acid.svg |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
| width = 200px |
|
| ImageFile = Benzoyl-peroxide.svg |
|
|
|
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png |
|
| ImageName = Skeletal formula |
|
|
|
| width2 = 200px |
|
| ImageFile1 = Benzoyl-peroxide-3D-balls.png |
|
|
|
|
|
| ImageName1 = Ball-and-stick model |
|
|
|
<!--Clinical data--> |
|
| IUPACName = dibenzoyl peroxide |
|
|
|
| Drugs.com = {{drugs.com|MTM|vitamin_c}} |
|
| OtherNames = benzoyl peroxide |
|
|
|
| licence_EU = <!-- EMEA requires brand name --> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| licence_US = <!-- FDA may use generic name --> |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| UNII = W9WZN9A0GM |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
| pregnancy_category = A |
|
| ChEMBL = <!-- blanked - oldvalue: 1200370 --> |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = general public availability |
|
|
| routes_of_administration = oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = rapid & complete |
|
|
| protein_bound = negligible |
|
|
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores --> |
|
|
| excretion = renal |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 50-81-7 |
|
|
| ATC_prefix = A |
|
|
| ATC_suffix = 11G |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 29073 |
|
|
| PubChem = 5785 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00126 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 10189562 |
|
|
| NIAID_ChemDB = 002072 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = PQ6CK8PD0R |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03093 |
|
| KEGG = D00018 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| InChI=1/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H |
|
|
|
| ChEMBL = 196 |
|
| InChIKey = OMPJBNCRMGITSC-UHFFFAOYAV |
|
|
|
|
|
| SMILES = c1ccc(cc1)C(=O)OOC(=O)c2ccccc2 |
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
|
| C=6 | H=7 | O=6 |
|
|
| molecular_weight = 176.12 g/] |
|
|
| smiles = C((1C(=C(C(=O)O1)O)O)O)O |
|
|
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H |
|
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OMPJBNCRMGITSC-UHFFFAOYSA-N |
|
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
| synonyms = <small>L</small>-ascorbic acid |
|
| CASNo = 94-36-0 |
|
|
|
| density = 1.694 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| melting_point = 190 |
|
| EC-number = 202-327-6 |
|
|
|
| boiling_point = 553 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 6919 |
|
|
| PubChem = 7187 |
|
|
| ATCCode_prefix = D10 |
|
|
| ATCCode_suffix = AE01 |
|
|
| ATC_Supplemental = {{ATCvet|D11|AX90}} |
|
|
| RTECS = DM8575000 |
|
|
| SMILES uygyhkjj |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| C=14|H=10 |O=4 |
|
|
| MolarMass = 242.23 g/mol |
|
|
| Appearance = colourless solid |
|
|
| Density = 1.334 g/cm<sup>3</sup> |
|
|
| MeltingPt = 103–105 °C decomp. |
|
|
| Solubility = poor |
|
|
}} |
|
|
| Section5 = {{Chembox Pharmacology |
|
|
| AdminRoutes = topical |
|
|
| Bioavail = |
|
|
| Metabolism = |
|
|
| HalfLife = |
|
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = OTC |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| PregCat = |
|
|
| PregCat_AU = |
|
|
| PregCat_US = C |
|
|
| Licence_US = Benzoyl+peroxide |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| EUIndex = 617-008-00-0 |
|
|
| EUClass = Explosive ('''E''')<br/>Irritant ('''Xi''') |
|
|
| RPhrases = {{R3}}, {{R7}}, {{R36}}, {{R43}} |
|
|
| SPhrases = {{S2}}, {{S3/7}}, {{S14}}, {{S36/37/39}} |
|
|
| NFPA-H = 3 |
|
|
| NFPA-F = 1 |
|
|
| NFPA-R = 3 |
|
|
| NFPA-O = ox |
|
|
| Autoignition = 80 °C |
|
|
}} |
|
|
}} |
|
}} |