Revision as of 12:07, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,098 edits Saving copy of the {{drugbox}} taken from revid 456981376 of page Faropenem for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 12:09, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,098 edits Saving copy of the {{drugbox}} taken from revid 447435911 of page Felbamate for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 443752184 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = ''(3-carbamoyloxy-2-phenylpropyl) carbamate'' |
|
| Watchedfields = changed |
|
|
⚫ |
| image = Felbamate.svg |
⚫ |
| verifiedrevid = 399927936 |
|
|
| IUPAC_name = |
|
| width = 150px |
⚫ |
| image = Faropenem.svg |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Felbatol |
|
| Drugs.com = {{drugs.com|international|faropenem}} |
|
| Drugs.com = {{drugs.com|monograph|felbamate}} |
|
|
| MedlinePlus = a606011 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| pregnancy_category = C (]) |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
⚫ |
| legal_status = Unscheduled |
⚫ |
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = > 90% |
|
⚫ |
| metabolism = ] |
|
| protein_bound = |
|
|
⚫ |
| elimination_half-life = 20-23 hours |
⚫ |
| metabolism = |
|
|
⚫ |
| excretion = ? |
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 106560-14-9 --> |
|
| CAS_number = 25451-15-4 |
|
| ATC_prefix = none |
|
| ATC_prefix = N03 |
|
| ATC_suffix = |
|
| ATC_suffix = AX10 |
|
| PubChem = 65894 |
|
| PubChem = 3331 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB00949 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 59303 |
|
| ChemSpiderID = 3214 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = F52Y83BGH3 |
|
| UNII = X72RBB02N8 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ChEBI = 51257 |
|
| KEGG = D00536 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 556262 |
|
| ChEBI = 4995 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1094 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=15 | N=1 | O=5 | S=1 |
|
| C=11 | H=14 | N=2 | O=4 |
|
| molecular_weight = 285.317 g/mol |
|
| molecular_weight = 238.24 |
|
| smiles = O=C2N1/C(=C(\S12(O)C)3OCCC3)C(=O)O |
|
| smiles = O=C(OCC(c1ccccc1)COC(=O)N)N |
|
| InChI = 1/C12H15NO5S/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6/h5-7,11,14H,2-4H2,1H3,(H,16,17)/t5-,6-,7+,11-/m1/s1 |
|
| InChI = 1/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
|
| InChIKey = HGGAKXAHAYOLDJ-FHZUQPTBBM |
|
| InChIKey = WKGXYQFOCVYPAC-UHFFFAOYAJ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H15NO5S/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6/h5-7,11,14H,2-4H2,1H3,(H,16,17)/t5-,6-,7+,11-/m1/s1 |
|
| StdInChI = 1S/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HGGAKXAHAYOLDJ-FHZUQPTBSA-N |
|
| StdInChIKey = WKGXYQFOCVYPAC-UHFFFAOYSA-N |
|
}} |
|
}} |