Revision as of 09:31, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 461695110 of page Valganciclovir for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Revision as of 09:36, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 461676886 of page Pyrazinamide for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 402848438 |
|
| verifiedrevid = 417854855 |
|
|
| IUPAC_name = pyrazine-2-carboxamide |
|
| IUPAC_name = 2--3-hydroxypropyl (2''S'')-2-amino-3-methylbutanoate |
|
|
| image = Valganciclovir.svg |
|
| image = Pyrazinamide.svg |
|
| width = 250 |
|
| width = 120 |
|
| imagename = mixture of diastereomers |
|
|
| drug_name = Valganciclovir |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Valcyte |
|
| tradename = Rifater |
|
| Drugs.com = {{drugs.com|monograph|valganciclovir-hydrochloride}} |
|
| Drugs.com = {{drugs.com|monograph|pyrazinamide}} |
|
| MedlinePlus = a605021 |
|
| MedlinePlus = a682402 |
|
| pregnancy_US = C |
|
| pregnancy_category = C |
|
| legal_UK = POM |
|
| legal_status = ? |
|
| legal_US = Rx-only |
|
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 60% |
|
| bioavailability = >90% |
|
|
| metabolism = ] |
|
| protein_bound = 1-2% |
|
|
⚫ |
| elimination_half-life = 9 to 10 hours |
|
| metabolism = ] to ] |
|
⚫ |
| elimination_half-life = 4 hours |
|
|
| excretion = ] |
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 175865-59-5 --> |
|
| CAS_number = 98-96-4 |
|
| ATC_prefix = J05 |
|
| ATC_prefix = J04 |
|
| ATC_suffix = AB14 |
|
| ATC_suffix = AK01 |
|
| PubChem = 64147 |
|
| PubChem = 1046 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01610 |
|
| DrugBank = DB00339 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 57721 |
|
| ChemSpiderID = 1017 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = GCU97FKN3R |
|
| UNII = 2KNI5N06TI |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00144 |
|
| ChEMBL = <!-- blanked - oldvalue: 1201314 --> |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
⚫ |
| C=14 | H=22 | N=6 | O=5 |
|
|
|
| ChEBI = 45285 |
⚫ |
| molecular_weight = 354.362 g/mol |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| smiles = O=C(OCC(OCn1c2N\C(=N/C(=O)c2nc1)N)CO)(N)C(C)C |
|
|
|
| ChEMBL = 614 |
|
| InChI = 1/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1 |
|
|
|
|
|
| InChIKey = WPVFJKSGQUFQAP-GKAPJAKFBD |
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=5 | H=5 | N=3 | O=1 |
|
⚫ |
| molecular_weight = 123.113 g/mol |
|
|
| smiles = O=C(N)c1nccnc1 |
|
|
| InChI = 1/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9) |
|
|
| InChIKey = IPEHBUMCGVEMRF-UHFFFAOYAZ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1 |
|
| StdInChI = 1S/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WPVFJKSGQUFQAP-GKAPJAKFSA-N |
|
| StdInChIKey = IPEHBUMCGVEMRF-UHFFFAOYSA-N |
|
}} |
|
}} |