Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 10:44, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 461521511 of page Irbesartan for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 10:46, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 461519097 of page Bekanamycin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| verifiedrevid = 443878113 | verifiedrevid = 461517751
| IUPAC_name = (2''S'',3''R'',4''S'',5''S'',6''R'')-4-amino-2-{oxy}-2-hydroxycyclohexyl]oxy}-6-(hydroxymethyl)oxane-3,5-diol
| IUPAC_name = 2-butyl-3-({4-phenyl}methyl)-1,3-diazaspironon-1-en-4-one
| image = Irbesartan skeletal.svg | image = Bekanamycin.png


<!--Clinical data--> <!--Clinical data-->
| tradename = Avapro | tradename =
| Drugs.com = {{drugs.com|monograph|irbesartan}} | Drugs.com = {{drugs.com|international|bekanamycin}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| MedlinePlus = a698009
| pregnancy_US = <!-- A / B / C / D / X -->
| licence_EU = Aprovel
⚫ | pregnancy_category =
| licence_US = Irbesartan
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | pregnancy_category = D <small>(])</small>
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_status = S4 <small>(Au)</small>, POM <small>(])</small>, ℞-only <small>(])</small>
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | routes_of_administration = Oral
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = Rx-only
⚫ | routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 60–80% | bioavailability =
| protein_bound = ~90% | protein_bound =
| metabolism = ] (]) | metabolism =
| elimination_half-life = 11–15 hours | elimination_half-life =
| excretion = ] 20%, ] 65% | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 138402-11-6 | CAS_number = <!-- blanked - oldvalue: 4696-76-8 -->
| ATC_prefix = C09 | CAS_supplemental =
| ATC_suffix = CA04 | ATC_prefix = none
| PubChem = 3749 | ATC_suffix =
| IUPHAR_ligand = 589 | ATC_supplemental =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01029
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 3618
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = J0E2756Z7N | UNII = 15JT14C3GI
⚫ | ChEMBL = 176
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00523 | ChEBI = 28098
| PubChem = 439318
| ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEBI = 5959
⚫ | ChemSpiderID = 388449
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| SMILES = C1((((1N)O2((((O2)CO)O)N)O)O)O3((((O3)CN)O)O)N)N
⚫ | ChEMBL = 1513
| InChI = 1/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1
| InChIKey = SKKLOUVUUNMCJE-FQSMHNGLBM
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = SKKLOUVUUNMCJE-FQSMHNGLSA-N


<!--Chemical data--> <!--Chemical data-->
| chemical_formula =
| C=25 | H=28 | N=6 | O=1 | C=18 | H=37 | As= | N=5 | O=10
| molecular_weight = 428.53 | molecular_weight = 483.51 g/mol
| smiles = O=C1N(\C(=N/C12CCCC2)CCCC)Cc5ccc(c3ccccc3c4nnnn4)cc5
| smiles = C1(((C(1N)O2((((O2)CO)O)N)O)O)O3((((O3)CN)O)O)N)N
| InChI = 1/C25H28N6O/c1-2-3-10-22-26-25(15-6-7-16-25)24(32)31(22)17-18-11-13-19(14-12-18)20-8-4-5-9-21(20)23-27-29-30-28-23/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,27,28,29,30)
| InChIKey = YOSHYTLCDANDAN-UHFFFAOYAO
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H28N6O/c1-2-3-10-22-26-25(15-6-7-16-25)24(32)31(22)17-18-11-13-19(14-12-18)20-8-4-5-9-21(20)23-27-29-30-28-23/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,27,28,29,30)
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = YOSHYTLCDANDAN-UHFFFAOYSA-N
}} }}

Revision as of 10:46, 21 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 461519097 of page Bekanamycin with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
  • none
Legal status
Legal status
  • In general: ℞ (Prescription only)
Identifiers
IUPAC name
  • (2S,3R,4S,5S,6R)-4-amino-2-{oxy}-2-hydroxycyclohexyl]oxy}-6-(hydroxymethyl)oxane-3,5-diol
PubChem CID
ChemSpider
UNII
ChEBI
ChEMBL
Chemical and physical data
FormulaC18H37N5O10
Molar mass483.51 g/mol g·mol
3D model (JSmol)
SMILES
  • C1((((1N)O2((((O2)CO)O)N)O)O)O3((((O3)CN)O)O)N)N
InChI
  • InChI=1S/C18H37N5O10/c19-2-6-11(26)12(27)9(23)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)8(22)10(25)7(3-24)31-18/h4-18,24-29H,1-3,19-23H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1
  • Key:SKKLOUVUUNMCJE-FQSMHNGLSA-N
  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic