Revision as of 13:41, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 456589690 of page Medroxyprogesterone for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 13:43, 23 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 456723397 of page Megestrol for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 407762744 |
|
| Watchedfields = changed |
|
|
⚫ |
| IUPAC_name = 17-acetyl-17-hydroxy-6,10, 13-trimethyl-2,8,9,11,12,14,15,16- octahydro-1H-cyclopenta phenanthren-3-one |
⚫ |
| verifiedrevid = 403686495 |
|
|
|
| image = Megestrol.svg |
|
|ImageFile=Medroxyprogesterone.svg |
|
|
|
|
|
|ImageSize=200px |
|
|
|
<!--Clinical data--> |
⚫ |
|IUPACName=17-acetyl-17-hydroxy- 6,10,13-trimethyl- 1,2,6,7,8,9,10,11,12,13,14,15,16,17- tetradecahydrocyclopentaphenanthren-3-one |
|
|
|
| tradename = Megace |
|
|OtherNames= |
|
|
|
| Drugs.com = {{drugs.com|monograph|megace}} |
|
|Section1={{Chembox Identifiers |
|
|
|
| MedlinePlus = a682003 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
⚫ |
| ChemSpiderID = 10185 |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| pregnancy_category = contraindicated |
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 279067 --> |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
| legal_US = <!-- OTC / Rx-only --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = 34 hours |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 3562-63-8 |
|
|
| ATC_prefix = G03 |
|
|
| ATC_suffix = AC05 |
|
|
| ATC_supplemental = {{ATC|G03|DB02}}, {{ATC|L02|AB01}} |
|
⚫ |
| PubChem = 19090 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB00351 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 18023 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = HSU1C9YRES |
|
| UNII = EA6LD1M70M |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
⚫ |
| InChI = 1/C22H32O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h12-13,16-18,25H,5-11H2,1-4H3/t13-,16+,17-,18-,20+,21-,22-/m0/s1 |
|
|
⚫ |
| KEGG = D08167 |
|
| InChIKey = FRQMUZJSZHZSGN-HBNHAYAOBM |
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1201139 --> |
|
|
| C=22 | H=30 | O=3 |
|
|
| molecular_weight = 342.472 g/mol |
|
⚫ |
| smiles = O=C4\C=C3\C(=C/1(CC2((O)(C(=O)C)CC12)C)3(C)CC4)C |
|
⚫ |
| InChI = 1/C22H30O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h11-12,16-18,25H,5-10H2,1-4H3/t16-,17+,18+,20-,21+,22+/m1/s1 |
|
|
| InChIKey = VXIMPSPISRVBPZ-NWUMPJBXBM |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H32O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h12-13,16-18,25H,5-11H2,1-4H3/t13-,16+,17-,18-,20+,21-,22-/m0/s1 |
|
| StdInChI = 1S/C22H30O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h11-12,16-18,25H,5-10H2,1-4H3/t16-,17+,18+,20-,21+,22+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FRQMUZJSZHZSGN-HBNHAYAOSA-N |
|
| StdInChIKey = VXIMPSPISRVBPZ-NWUMPJBXSA-N |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=520-85-4 |
|
⚫ |
| PubChem=10631 |
|
⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
⚫ |
| KEGG = D08166 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB00603 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 6715 |
|
⚫ |
| SMILES = O=C4\C=C2/(1CC3((O)(C(=O)C)CC31C2C)C)(C)CC4 |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula=C<sub>22</sub>H<sub>32</sub>O<sub>3</sub> |
|
|
| MolarMass=344.488 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |