Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 14:07, 24 November 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 456630303 of page Nitrofurazone for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit		Revision as of 14:10, 24 November 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 443445462 of page Nitrous_acid for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~drugbox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Drugbox~~		{{Chembox
	\| Verifiedfields = changed		\| Verifiedfields = changed
			\| Watchedfields = changed
	\| verifiedrevid = ~~440912283~~		\| verifiedrevid = 396509456
	\| IUPAC_name = 5-nitro-2-furaldehyde semicarbazone
			\| ImageFile = Nitrous acid acsv.svg
	\| image = Nitrofurazone.png
			\| ImageSize = 200px

			\| ImageName = Nitrous acid
	<!--Clinical data-->
	\| ~~tradename~~ =		\| PIN = Nitrous acid
			\| SystematicName = Hydroxidooxidonitrogen
	\| Drugs.com = {{drugs.com\|CONS\|nitrofurazone}}
			\| Section1 = {{Chembox Identifiers
	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
			\| CASNo = 7782-77-6
	\| pregnancy_US = <!-- A / B / C / D / X -->
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| pregnancy_category =
		⚫	\| PubChem = 24529
	\| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
			\| PubChem_Ref = {{Pubchemcite}}
	\| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
		⚫	\| ChemSpiderID = 22936
	\| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
			\| EINECS = 231-963-7
	\| legal_status =
		⚫	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| routes_of_administration =
			\| KEGG = <!-- blanked - oldvalue: C00088 -->

			\| MeSHName = Nitrous+acid
	<!--Pharmacokinetic data-->
		⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| bioavailability =
	\| ~~protein_bound~~ =		\| ChEBI = 25567
	\| ~~metabolism~~ =		\| SMILES = O=NO
		⚫	\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
	\| elimination_half-life =
	\| ~~excretion~~ =		\| ChEMBL = 1161681

	<!--Identifiers-->
⚫	\| ~~CAS_number_Ref~~ = {{cascite\|correct\|??}}
	\| CAS_number = 59-87-0
	\| CAS_supplemental =
	\| ATC_prefix = B05
	\| ATC_suffix = CA03
	\| ATC_supplemental = {{ATC\|D08\|AF01}} {{ATC\|D09\|AA03}} {{ATC\|P01\|CC02}} {{ATC\|S01\|AX04}} {{ATC\|S02\|AA02}} {{ATCvet\|G01\|AX90}} {{ATCvet\|P51\|AC02}}
⚫	\| PubChem = ~~5447130~~
	\| DrugBank_Ref = {{drugbankcite\|changed\|drugbank}}
	\| DrugBank = DB00336
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
⚫	\| ChemSpiderID = ~~4566720~~
⚫	\| ~~UNII_Ref~~ = {{~~fdacite~~\|changed\|~~FDA~~}}
	\| UNII = X8XI70B5Z6
⚫	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = D00862
⚫	\| ~~ChEMBL_Ref~~ = {{ebicite\|correct\|EBI}}
	\| ChEMBL = 869

	<!--Chemical data-->
	\| chemical_formula =
	\| C=6 \| H=6 \| N=4 \| O=4
	\| molecular_weight = 198.14 g/mol
	\| smiles = O=()c1oc(/C=N/NC(=O)N)cc1
	\| InChI = 1/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+
	\| InChIKey = IAIWVQXQOWNYOU-FPYGCLRLBW
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C6H6N4O4~~/c7-~~6(11)9-8~~-3~~-4-1-2-5(14-4)10(12)13~~/~~h1-3H,~~(H3,7,~~9,11~~)~~/b8-3+~~		\| StdInChI = 1S/HNO2/c2-1-3/h(H,2,3)
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~IAIWVQXQOWNYOU~~-~~FPYGCLRLSA~~-N		\| StdInChIKey = IOVCWXUNBOPUCH-UHFFFAOYSA-N
			\| Gmelin = 983
			\| 3DMet = B00022}}
			\| Section2 = {{Chembox Properties
			\| Formula = HNO<sub>2</sub>
			\| Appearance = Pale blue solution
			\| MolarMass = 47.013 g/mol
			\| Density = Approx. 1 g/ml
			\| Solubility =
			\| MeltingPt = Only known in solution
			\| pKa = 3.398
			}}
			\| Section7 = {{Chembox Hazards
			\| ExternalMSDS =
			\| EUIndex = Not listed
			\| EUClass =
			\| RPhrases =
			\| SPhrases =
			\| MainHazards =
			\| NFPA-H =
			\| NFPA-F =
			\| NFPA-R =
			\| NFPA-O =
			\| FlashPt = Non-flammable
			}}
			\| Section8 = {{Chembox Related
			\| OtherAnions = ]
			\| OtherCations = ]<br/>]<br/>]
			\| OtherCpds = ]
			}}
	}}		}}

Revision as of 14:10, 24 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 443445462 of page Nitrous_acid with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
Nitrous acid
Preferred IUPAC name Nitrous acid
Systematic IUPAC name Hydroxidooxidonitrogen
Identifiers
CAS Number	7782-77-6
3D model (JSmol)	Interactive image
ChEBI	CHEBI:25567
ChEMBL	ChEMBL1161681
ChemSpider	22936
EC Number	231-963-7
Gmelin Reference	983
MeSH	Nitrous+acid
PubChem CID	24529
InChI InChI=1S/HNO2/c2-1-3/h(H,2,3)Key: IOVCWXUNBOPUCH-UHFFFAOYSA-N
SMILES O=NO
Properties
Chemical formula	HNO₂
Molar mass	47.013 g/mol
Appearance	Pale blue solution
Density	Approx. 1 g/ml
Melting point	Only known in solution
Acidity (pK_a)	3.398
Hazards
Flash point	Non-flammable
Related compounds
Other anions	Nitric acid
Other cations	Sodium nitrite Potassium nitrite Ammonium nitrite
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound