Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:39, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 456966867 of page Omeprazole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 14:40, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 456671016 of page Opipramol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox| Verifiedfields = changed {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 419941151 | verifiedrevid = 412529301
| IUPAC_name = 4-azepin- 5-yl)propyl]-1-piperazinethanol
| drug_name = Omeprazole
| image = Opipramol2.svg
|IUPAC_name = (''RS'')-6-methoxy-2-((4-methoxy-3,5-dimethylpyridin-2-yl) methylsulfinyl)-1''H''-benzoimidazole

| image = Omeprazole.svg
<!--Clinical data-->
| imagename = 1 : 1 mixture (racemate)
| tradename =
| width=220
| Drugs.com = {{drugs.com|international|opipramol}}
| image2 = Omeprazole_3d_structure.png
| pregnancy_category =
| width = 220
| legal_status = Rx-only
| CASNo_Ref = {{cascite|correct|CAS}}
| routes_of_administration = Oral
| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KG60484QX9
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = <!-- blanked - oldvalue: 315-72-0 -->
| ATC_prefix = N06
| ATC_suffix = AA05
| PubChem = 9417
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9046
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = D23ZXO613C
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00455 | KEGG = D08297
| InChI = 1/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20)
| InChIKey = SUBDBMMJDZJVOS-UHFFFAOYAZ
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1503 | ChEMBL = 370753

<!--Chemical data-->
| C=23 | H=29 | N=3 | O=1
| molecular_weight = 363.496 g/mol
| smiles = OCCN1CCN(CC1)CCCN4c2ccccc2\C=C/c3ccccc34
| InChI = 1/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2
| InChIKey = YNZFUWZUGRBMHL-UHFFFAOYAZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20) | StdInChI = 1S/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SUBDBMMJDZJVOS-UHFFFAOYSA-N | StdInChIKey = YNZFUWZUGRBMHL-UHFFFAOYSA-N
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number=73590-58-6
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4433
| ATC_prefix=A02
| ATC_suffix=BC01
| ATC_supplemental=
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 7772
| PubChem=4594
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00338
| C = 17 | H = 19 | N = 3 | O = 3 | S = 1
| molecular_weight = 345.4 g/mol
| smiles = O=S(c2nc1ccc(OC)cc1n2)Cc3ncc(c(OC)c3C)C
| bioavailability= 35–76%<ref>. AstraZeneca Pharmaceuticals.</ref><ref>{{cite journal
| last1 = Vaz-Da-Silva | first1 = M
| last2 = Loureiro | first2 = AI
| last3 = Nunes | first3 = T
| last4 = Maia | first4 = J
| last5 = Tavares | first5 = S
| last6 = Falcão | first6 = A
| last7 = Silveira | first7 = P
| last8 = Almeida | first8 = L
| last9 = Soares-Da-Silva | first9 = P
| title = Bioavailability and bioequivalence of two enteric-coated formulations of omeprazole in fasting and fed conditions
| journal = ]
| volume = 25
| issue = 6
| pages = 391–9
| year = 2005
| pmid = 17532679
| url = http://www.medscape.com/viewarticle/508018
| doi = 10.2165/00044011-200525060-00004
}}</ref>
| protein_bound = 95%
| metabolism = ] (], ])
| elimination_half-life= 1 – 1.2 hours
| excretion = 80% ]<br>20% ]
| pregnancy_US = C
| pregnancy_AU = B3
| legal_AU = S4
| legal_UK = POM
| legal_US = OTC
| routes_of_administration= Oral, ]
| licence_US = Omeprazole
}} }}

Revision as of 14:40, 24 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456671016 of page Opipramol with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comInternational Drug Names
Routes of
administration
Oral
ATC code
Legal status
Legal status
  • In general: ℞ (Prescription only)
Identifiers
IUPAC name
  • 4-azepin- 5-yl)propyl]-1-piperazinethanol
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC23H29N3O
Molar mass363.496 g/mol g·mol
3D model (JSmol)
SMILES
  • OCCN1CCN(CC1)CCCN4c2ccccc2\C=C/c3ccccc34
InChI
  • InChI=1S/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2
  • Key:YNZFUWZUGRBMHL-UHFFFAOYSA-N
  (what is this?)  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic