Revision as of 14:39, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 456966867 of page Omeprazole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 14:40, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 456671016 of page Opipramol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox| Verifiedfields = changed |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 419941151 |
|
| verifiedrevid = 412529301 |
|
|
| IUPAC_name = 4-azepin- 5-yl)propyl]-1-piperazinethanol |
|
| drug_name = Omeprazole |
|
|
⚫ |
| image = Opipramol2.svg |
|
|IUPAC_name = (''RS'')-6-methoxy-2-((4-methoxy-3,5-dimethylpyridin-2-yl) methylsulfinyl)-1''H''-benzoimidazole |
|
|
|
|
⚫ |
| image = Omeprazole.svg |
|
|
|
<!--Clinical data--> |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
|
| tradename = |
|
| width=220 |
|
|
|
| Drugs.com = {{drugs.com|international|opipramol}} |
|
| image2 = Omeprazole_3d_structure.png |
|
|
|
| pregnancy_category = |
|
| width = 220 |
|
|
|
| legal_status = Rx-only |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
⚫ |
| routes_of_administration = Oral |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
|
⚫ |
| UNII = KG60484QX9 |
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 315-72-0 --> |
|
⚫ |
| ATC_prefix = N06 |
|
⚫ |
| ATC_suffix = AA05 |
|
⚫ |
| PubChem = 9417 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 9046 |
|
⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
⚫ |
| UNII = D23ZXO613C |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00455 |
|
| KEGG = D08297 |
|
| InChI = 1/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20) |
|
⚫ |
| InChIKey = SUBDBMMJDZJVOS-UHFFFAOYAZ |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1503 |
|
| ChEMBL = 370753 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=23 | H=29 | N=3 | O=1 |
|
⚫ |
| molecular_weight = 363.496 g/mol |
|
|
| smiles = OCCN1CCN(CC1)CCCN4c2ccccc2\C=C/c3ccccc34 |
|
|
| InChI = 1/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2 |
|
⚫ |
| InChIKey = YNZFUWZUGRBMHL-UHFFFAOYAZ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20) |
|
| StdInChI = 1S/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SUBDBMMJDZJVOS-UHFFFAOYSA-N |
|
| StdInChIKey = YNZFUWZUGRBMHL-UHFFFAOYSA-N |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number=73590-58-6 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4433 |
|
⚫ |
| ATC_prefix=A02 |
|
⚫ |
| ATC_suffix=BC01 |
|
|
| ATC_supplemental= |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 7772 |
|
⚫ |
| PubChem=4594 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00338 |
|
⚫ |
| C = 17 | H = 19 | N = 3 | O = 3 | S = 1 |
|
⚫ |
| molecular_weight = 345.4 g/mol |
|
|
| smiles = O=S(c2nc1ccc(OC)cc1n2)Cc3ncc(c(OC)c3C)C |
|
|
| bioavailability= 35–76%<ref>. AstraZeneca Pharmaceuticals.</ref><ref>{{cite journal |
|
|
| last1 = Vaz-Da-Silva | first1 = M |
|
|
| last2 = Loureiro | first2 = AI |
|
|
| last3 = Nunes | first3 = T |
|
|
| last4 = Maia | first4 = J |
|
|
| last5 = Tavares | first5 = S |
|
|
| last6 = Falcão | first6 = A |
|
|
| last7 = Silveira | first7 = P |
|
|
| last8 = Almeida | first8 = L |
|
|
| last9 = Soares-Da-Silva | first9 = P |
|
|
| title = Bioavailability and bioequivalence of two enteric-coated formulations of omeprazole in fasting and fed conditions |
|
|
| journal = ] |
|
|
| volume = 25 |
|
|
| issue = 6 |
|
|
| pages = 391–9 |
|
|
| year = 2005 |
|
|
| pmid = 17532679 |
|
|
| url = http://www.medscape.com/viewarticle/508018 |
|
|
| doi = 10.2165/00044011-200525060-00004 |
|
|
}}</ref> |
|
|
| protein_bound = 95% |
|
|
| metabolism = ] (], ]) |
|
⚫ |
| elimination_half-life= 1 – 1.2 hours |
|
|
| excretion = 80% ]<br>20% ] |
|
|
| pregnancy_US = C |
|
|
| pregnancy_AU = B3 |
|
|
| legal_AU = S4 |
|
|
| legal_UK = POM |
|
|
| legal_US = OTC |
|
⚫ |
| routes_of_administration= Oral, ] |
|
|
| licence_US = Omeprazole |
|
|
}} |
|
}} |