Revision as of 15:55, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 444042942 of page Patulin for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit |
Revision as of 15:56, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 400843689 of page Paxilline for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 400842436 |
|
| Verifiedfields = changed |
|
|
|
|ImageFile=Paxilline.png |
⚫ |
| verifiedrevid = 408789487 |
|
|
|
|ImageSize=200px |
|
| Reference = <ref name="Merck"/> |
|
|
|
|IUPACName= (2''R'',​4b''S'',​6a''S'',​12b''S'',​12c''R'',​14a''S'')-​4b-​hydroxy-​2-​(1-​hydroxy-​1-​methylethyl)-​12b,​12c-​dimethyl-​5,​6,​6a,​7,​12,​12b,​12c,​13,​14,​14a-​decahydro-​2''H''-​chromeno​​indeno​​indol-​3(4b''H'')-​one |
|
| ImageFileL1 = Patulin.png |
|
|
|
|OtherNames= |
|
| ImageSizeL1 = 120px |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| ImageFileR1=Patulin_3d_structure.png |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ImageSizeR2 = 120px |
|
|
⚫ |
| ChemSpiderID = 94753 |
|
| IUPACName = 4-hydroxy-4''H''-furopyran-2(6''H'')-one |
|
|
|
| InChI = 1/C27H33NO4/c1-24(2,30)23-20(29)14-18-21(32-23)10-11-25(3)26(4)15(9-12-27(18,25)31)13-17-16-7-5-6-8-19(16)28-22(17)26/h5-8,14-15,21,23,28,30-31H,9-13H2,1-4H3/t15-,21-,23-,25+,26+,27+/m0/s1 |
|
| OtherNames = 2-Hydroxy-3,7-dioxabicyclonona-5,9-dien-8-one<br /> |
|
|
|
| InChIKey = ACNHBCIZLNNLRS-UBGQALKQBX |
|
Clairformin<br />Claviform<br />Expansine<br />Clavacin<br />Clavatin<br />Expansin<br />Gigantin<br />Leucopin<br />Patuline |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4534 |
|
|
| InChI = 1/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2 |
|
|
| InChIKey = ZRWPUFFVAOMMNM-UHFFFAOYAU |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 294018 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C27H33NO4/c1-24(2,30)23-20(29)14-18-21(32-23)10-11-25(3)26(4)15(9-12-27(18,25)31)13-17-16-7-5-6-8-19(16)28-22(17)26/h5-8,14-15,21,23,28,30-31H,9-13H2,1-4H3/t15-,21-,23-,25+,26+,27+/m0/s1 |
|
| StdInChI = 1S/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZRWPUFFVAOMMNM-UHFFFAOYSA-N |
|
| StdInChIKey = ACNHBCIZLNNLRS-UBGQALKQSA-N |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 57186-25-1 --> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 149-29-1 |
|
| ChEMBL = 410063 |
|
⚫ |
| PubChem=105008 |
|
| EINECS = 205-735-2 |
|
|
|
| SMILES = O=C5/C=C6/4(O)CC3Cc2c1ccccc1nc23(4(CC6O5C(O)(C)C)C)C |
⚫ |
| PubChem = 4696 |
|
|
⚫ |
| MeSHName=Paxilline |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
|
}} |
⚫ |
| KEGG = <!-- blanked - oldvalue: C16748 --> |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
|C=27|H=33|N=1|O=4 |
|
| UNII = 95X2BV4W8R |
|
|
⚫ |
| MolarMass=435.56 g/mol |
|
| SMILES = O=C\1O/C2=C/COC(O)C2=C/1 |
|
|
⚫ |
| Appearance= |
|
| InChI = |
|
|
| RTECS = |
|
| Density= |
|
|
| MeltingPt= |
⚫ |
| MeSHName = |
|
|
⚫ |
| BoilingPt= |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = |
|
| Solubility= |
|
|
}} |
|
| ATCCode_prefix = |
|
|
⚫ |
|Section3={{Chembox Hazards |
|
| ATCCode_suffix = |
|
|
⚫ |
| MainHazards= |
|
| ATC_Supplemental =}} |
|
|
⚫ |
| FlashPt= |
⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
| Autoignition= |
⚫ |
| C=7|H=6|O=4 |
|
|
|
}} |
⚫ |
| MolarMass = 154.12 g/mol |
|
⚫ |
| Appearance = Compact prisms |
|
|
| Density = |
|
|
| MeltingPtC = 110 |
|
|
| Melting_notes = |
|
⚫ |
| BoilingPt = |
|
|
| Boiling_notes = |
|
|
| Solubility = Soluble |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb = }} |
|
⚫ |
| Section7 = {{Chembox Hazards |
|
|
| EUClass = |
|
|
| EUIndex = |
|
⚫ |
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
⚫ |
| FlashPt = |
|
⚫ |
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
|
}} |
|
}} |