| Revision as of 13:29, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,077 edits Saving copy of the {{drugbox}} taken from revid 447905693 of page Policresulen for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 13:29, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,077 edits Saving copy of the {{drugbox}} taken from revid 458184665 of page Poly_ICLC for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 400856843 |
|
| verifiedrevid = 447996086 |
|
| IUPAC_name = |
|
| IUPAC_name = |
|
| image = Policresulen.png |
|
| image = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|policresulen}} |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = topical |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 26: |
Line 26: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| CAS_number = <!-- blanked - oldvalue: 101418-00-2 --> |
|
|
| CAS_supplemental = |
|
| ChemSpiderID = NA |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
| ⚫ |
| ATC_prefix = D08 |
|
|
| ATC_suffix = AE02 |
|
| CAS_number = |
|
⚫ |
| ATC_prefix = L03 |
|
| ATC_supplemental = {{ATC|G01|AX03}} {{ATCvet|G51|AD02}} |
|
|
| PubChem = 3050404 |
|
| ATC_suffix = AX08 |
|
|
| PubChem = |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 2312470 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = (C<sub>9</sub>H<sub>8</sub>O<sub>4</sub>S)<sub>n</sub> |
|
| chemical_formula = |
|
|
|
|
| C= | H= | N= | O= |
|
|
| molecular_weight = variable |
|
| molecular_weight = |
|
| smiles = O=S(=O)(O)c1cc(c(cc1O)C)Cc2cc(c(O)c(c2C)Cc3cc(c(O)cc3C)S(=O)(=O)O)S(=O)(=O)O |
|
|
| InChI = 1/C23H24O12S3/c1-11-4-18(24)20(36(27,28)29)8-14(11)6-16-10-22(38(33,34)35)23(26)17(13(16)3)7-15-9-21(37(30,31)32)19(25)5-12(15)2/h4-5,8-10,24-26H,6-7H2,1-3H3,(H,27,28,29)(H,30,31,32)(H,33,34,35) |
|
|
| InChIKey = ACZKMKGNTMOPBD-UHFFFAOYAL |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C23H24O12S3/c1-11-4-18(24)20(36(27,28)29)8-14(11)6-16-10-22(38(33,34)35)23(26)17(13(16)3)7-15-9-21(37(30,31)32)19(25)5-12(15)2/h4-5,8-10,24-26H,6-7H2,1-3H3,(H,27,28,29)(H,30,31,32)(H,33,34,35) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = ACZKMKGNTMOPBD-UHFFFAOYSA-N |
|
|
}} |
|
}} |
