Revision as of 10:56, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 464290800 of page Lidocaine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 10:59, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464319253 of page Malvidin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{Drugbox| Verifiedfields = changed |
|
|
| verifiedrevid = 417820511 |
|
| verifiedrevid = 440126448 |
|
|
| ImageFile=malvidin.png |
|
| IUPAC_name = 2-(diethylamino)-<br />''N''-(2,6-dimethylphenyl)acetamide |
|
|
|
| ImageSize=250px |
|
| image = Lidocaine.svg |
|
|
|
| IUPACName=3,5,7-trihydroxy-2-(4-hydroxy- 3,5-dimethoxyphenyl)chromenium |
|
| width = 200px |
|
|
|
| OtherNames= |
|
| image2 = Lidocaine-from-xtal-3D-balls.png |
|
|
|
|Section1= {{Chembox Identifiers |
|
| width2 = 200px |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
⚫ |
| ChemSpiderID = 140095 |
|
<!--Clinical data--> |
|
|
| tradename = Xylocaine |
|
| ChEMBL2 = 592005 |
|
| Drugs.com = {{drugs.com|CONS|lidocaine}} |
|
|
| pregnancy_AU = A |
|
|
| pregnancy_US = B |
|
|
| legal_AU = S4 |
|
|
| legal_US = Rx Only (U.S.) (excluding 1%) |
|
|
| routes_of_administration = ], ], ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 35% (oral) <br /> 3% (topical) |
|
|
| metabolism = ], 90% ]-mediated |
|
|
| elimination_half-life = 1.5–2 hours |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 137-58-6 |
|
|
| CAS_supplemental = <br/>{{CAS|73-78-9}} (hydrochloride) |
|
|
| ATC_prefix = N01 |
|
|
| ATC_suffix = BB02 |
|
|
| ATC_supplemental = {{ATC|C01|BB01}} {{ATC|D04|AB01}} {{ATC|S02|DA01}} {{ATC|C05|AD01}} |
|
⚫ |
| PubChem = 3676 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00281 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 3548 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 98PI200987 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00358 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 6456 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 79 |
|
| ChEMBL = 255753 |
|
|
| InChI = 1/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1 |
|
|
|
|
|
| InChIKey = KZMACGJDUUWFCH-IKLDFBCSAG |
|
<!--Chemical data--> |
|
|
| C=14 | H=22 | N=2 | O=1 |
|
|
| molecular_weight = 234.34 g/mol |
|
|
| smiles = O=C(Nc1c(cccc1C)C)CN(CC)CC |
|
|
| InChI = 1/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
|
| StdInChI = 1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NNJVILVZKWQKPM-UHFFFAOYSA-N |
|
| StdInChIKey = KZMACGJDUUWFCH-UHFFFAOYSA-O |
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
| synonyms = ''N''-(2,6-dimethylphenyl)-''N''<sup>2</sup>,''N''<sup>2</sup>-diethylglycinamide |
|
|
|
| CASNo = <!-- blanked - oldvalue: 643-84-5 --> |
|
| melting_point = 68 |
|
|
⚫ |
| PubChem=159287 |
|
|
| SMILES = O(c1cc(cc(OC)c1O)c3c2cc(O)cc(O)c2cc3O)C |
|
|
}} |
|
|
|Section2= {{Chembox Properties |
|
|
| Formula=C<sub>17</sub>H<sub>15</sub>O<sub>7</sub>+ |
|
|
| MolarMass = 331.2968 g/mol |
|
|
| ExactMass = 331.081778 |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |