Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 10:56, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 464290800 of page Lidocaine for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 10:59, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464319253 of page Malvidin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox
{{Drugbox| Verifiedfields = changed
| verifiedrevid = 417820511 | verifiedrevid = 440126448
| ImageFile=malvidin.png
| IUPAC_name = 2-(diethylamino)-<br />''N''-(2,6-dimethylphenyl)acetamide
| ImageSize=250px
| image = Lidocaine.svg
| IUPACName=3,5,7-trihydroxy-2-(4-hydroxy- 3,5-dimethoxyphenyl)chromenium
| width = 200px
| OtherNames=
| image2 = Lidocaine-from-xtal-3D-balls.png
|Section1= {{Chembox Identifiers
| width2 = 200px
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 140095
<!--Clinical data-->
| tradename = Xylocaine | ChEMBL2 = 592005
| Drugs.com = {{drugs.com|CONS|lidocaine}}
| pregnancy_AU = A
| pregnancy_US = B
| legal_AU = S4
| legal_US = Rx Only (U.S.) (excluding 1%)
| routes_of_administration = ], ], ]

<!--Pharmacokinetic data-->
| bioavailability = 35% (oral) <br /> 3% (topical)
| metabolism = ], 90% ]-mediated
| elimination_half-life = 1.5–2 hours
| excretion = ]

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 137-58-6
| CAS_supplemental = <br/>{{CAS|73-78-9}} (hydrochloride)
| ATC_prefix = N01
| ATC_suffix = BB02
| ATC_supplemental = {{ATC|C01|BB01}} {{ATC|D04|AB01}} {{ATC|S02|DA01}} {{ATC|C05|AD01}}
| PubChem = 3676
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00281
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3548
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 98PI200987
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00358
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 6456
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 79 | ChEMBL = 255753
| InChI = 1/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1

| InChIKey = KZMACGJDUUWFCH-IKLDFBCSAG
<!--Chemical data-->
| C=14 | H=22 | N=2 | O=1
| molecular_weight = 234.34 g/mol
| smiles = O=C(Nc1c(cccc1C)C)CN(CC)CC
| InChI = 1/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) | StdInChI = 1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NNJVILVZKWQKPM-UHFFFAOYSA-N | StdInChIKey = KZMACGJDUUWFCH-UHFFFAOYSA-O
| CASNo_Ref = {{cascite|correct|??}}
| synonyms = ''N''-(2,6-dimethylphenyl)-''N''<sup>2</sup>,''N''<sup>2</sup>-diethylglycinamide
| CASNo = <!-- blanked - oldvalue: 643-84-5 -->
| melting_point = 68
| PubChem=159287
| SMILES = O(c1cc(cc(OC)c1O)c3c2cc(O)cc(O)c2cc3O)C
}}
|Section2= {{Chembox Properties
| Formula=C<sub>17</sub>H<sub>15</sub>O<sub>7</sub>+
| MolarMass = 331.2968 g/mol
| ExactMass = 331.081778
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}} }}

Revision as of 10:59, 6 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 464319253 of page Malvidin with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name 3,5,7-trihydroxy-2-(4-hydroxy- 3,5-dimethoxyphenyl)chromenium
Identifiers
3D model (JSmol)
ChEMBL
ChemSpider
PubChem CID
InChI
  • InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1Key: KZMACGJDUUWFCH-UHFFFAOYSA-O
  • InChI=1/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1Key: KZMACGJDUUWFCH-IKLDFBCSAG
SMILES
  • O(c1cc(cc(OC)c1O)c3c2cc(O)cc(O)c2cc3O)C
Properties
Chemical formula C17H15O7+
Molar mass 331.2968 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic