Revision as of 18:34, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 444130296 of page TFM_(piscicide) for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 18:34, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 447763212 of page THC-O-acetate for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| verifiedrevid = 444128431 |
|
| verifiedrevid = 401616226 |
|
|
| IUPAC_name = O-acetyl-Δ9-tetrahydrocannabinol |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
| image = THC-O-acetate.svg |
|
| ImageFile = 3-Trifluoromethyl-4-nitrophenol.png |
|
|
| ImageSize = 120px |
|
| width = 160 |
|
|
|
|
| IUPACName = 4-nitro-3-(trifluoromethyl)phenol |
|
|
|
<!--Clinical data--> |
|
| OtherNames = |
|
|
|
| tradename = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| legal_status = Class A (UK) |
|
| InChI = 1/C7H4F3NO3/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h1-3,12H |
|
|
|
|
|
| InChIKey = ZEFMBAFMCSYJOO-UHFFFAOYAI |
|
|
|
<!--Identifiers--> |
|
| InChI1 = 1S/C7H4F3NO3/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h1-3,12H |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 23132-17-4 --> |
|
| InChIKey1 = ZEFMBAFMCSYJOO-UHFFFAOYSA-N |
|
|
⚫ |
| PubChem = 198013 |
⚫ |
| CASNo = <!-- blanked - oldvalue: 88-30-2 --> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
| PubChem = 6931 |
|
|
⚫ |
| ChemSpiderID = 171383 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
⚫ |
| ChemSpiderID = 6665 |
|
|
|
<!--Chemical data--> |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| C=23 | H=32 | O=3 |
⚫ |
| StdInChIKey = ZEFMBAFMCSYJOO-UHFFFAOYSA-N |
|
|
|
| molecular_weight = 356.498 g/mol |
|
| SMILES = O=()c1c(cc(O)cc1)C(F)(F)F |
|
|
|
| smiles = O=C(Oc2cc(cc1OC(3CC/C(=C\3c12)C)(C)C)CCCCC)C |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| InChI = 1/C23H32O3/c1-6-7-8-9-17-13-20(25-16(3)24)22-18-12-15(2)10-11-19(18)23(4,5)26-21(22)14-17/h12-14,18-19H,6-11H2,1-5H3/t18-,19-/m1/s1 |
|
| StdInChI =1S/C7H4F3NO3/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h1-3,12H |
|
|
|
| InChIKey = DEWSJDIJFWQLOA-RTBURBONBA |
|
}} |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| Section2 = {{Chembox Properties |
|
|
|
| StdInChI = 1S/C23H32O3/c1-6-7-8-9-17-13-20(25-16(3)24)22-18-12-15(2)10-11-19(18)23(4,5)26-21(22)14-17/h12-14,18-19H,6-11H2,1-5H3/t18-,19-/m1/s1 |
⚫ |
| C=7 | H=4 | F=3 | N=1 | O=3 |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| Appearance = |
|
|
⚫ |
| StdInChIKey = DEWSJDIJFWQLOA-RTBURBONSA-N |
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
|
}} |
|
}} |