Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 19:12, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 466844283 of page Sulfurous_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 19:13, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 469384763 of page Sulfur_trioxide for the Chem/Drugbox validation project (updated: 'ChEBI').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 417930064 | verifiedrevid = 413343925
| Name = Sulfurous acid
| ImageFileL1 = Sulfur-trioxide-2D-dimensions.svg
| ImageSizeL1 = 135px
⚫ | ImageFile_Ref = {{chemboximage|correct|??}}
| ImageNameL1 = Structure and dimensions of sulfur trioxide
| ImageFile = Sulfurous-acid-2D-pyramidal.png
| ImageFileR1 = Sulfur-trioxide-3D-vdW.png
| ImageSize = 150px
| ImageName = Sulfurous acid | ImageSizeR1 = 120px
| ImageNameR1 = Space-filling model of sulfur trioxide
| ImageFile1 = Sulfurous-acid-3D-balls.png
| PIN = Sulfur trioxide
| ImageSize1 = 200px
| SystematicName = Sulfonylideneoxidane
| ImageName1 = Ball-and-stick model of sulfurous acid
| OtherNames = Sulfan{{Verify source|date=September 2010}}<br />
| IUPACName = Sulfurous acid
Sulfuric anhydride
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| InChI1 = 1/O3S/c1-4(2)3
| InChIKey1 = AKEJUJNQAAGONA-UHFFFAOYAX
⚫ | CASNo = 7446-11-9
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 3162-58-1
| CASNo1_Comment = <br />(monokis(trimethylammoniate))
| PubChem = 24682
| PubChem_Ref = {{Pubchemcite}}
| PubChem1 = 22235242
| PubChem1_Comment = <br>(hemihydrate)
| PubChem1_Ref = {{Pubchemcite}}
| PubChem2 = 22235243
| PubChem2_Comment = (monoammoniate)
| PubChem2_Ref = {{Pubchemcite}}
| PubChem3 = 23035042
| PubChem3_Comment = (monohydrate)
| PubChem3_Ref = {{Pubchemcite}}
| PubChem4 = 19427588
| PubChem4_Comment = (monoformamate)
| PubChem4_Ref = {{Pubchemcite}}
| PubChem5 = 222852
| PubChem5_Comment = <br>(monokis(trimethylammoniate))
| PubChem5_Ref = {{Pubchemcite}}
⚫ | ChemSpiderID = 23080
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 231-197-3
⚫ | ChemSpiderID = 1069
| PubChem = 1100 | UNNumber = UN 1829
| UNII_Ref = {{fdacite|correct|FDA}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| UNII = J1P7893F4J | ChEBI = 29384
| RTECS = WT4830000
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫ | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| KEGG = C00094
| InChI = 1/H2O3S/c1-4(2)3/h(H2,1,2,3) | StdInChI = 1S/O3S/c1-4(2)3
⚫ | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| InChIKey = LSNNMFCWUKXFEE-UHFFFAOYAJ
⚫ | StdInChIKey = AKEJUJNQAAGONA-UHFFFAOYSA-N
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 48854 | SMILES = O=S(=O)=O
| SMILES = O=S(O)O | InChI = 1S/O3S/c1-4(2)3
| InChIKey = AKEJUJNQAAGONA-UHFFFAOYSA-N
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1161699 | Gmelin = 1448}}
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/H2O3S/c1-4(2)3/h(H2,1,2,3)
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = LSNNMFCWUKXFEE-UHFFFAOYSA-N
⚫ | CASNo = 7782-99-2
| CASNo_Ref = {{cascite|correct|CAS}}
⚫ }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = H<sub>2</sub>SO<sub>3</sub> | Formula = SO<sub>3</sub>
| MolarMass = 82.07 g/mol | MolarMass = 80.066 g/mol<!--2009Weight-->
| pKa = 1.857, 7.172 | Density = 1.92 g/cm<sup>3</sup>, liquid
| MeltingPt = 16.9 °C, 290.1 K, 62.4 °F
}}
| BoilingPtC = 45
⚫ | Solubility = ] to ]
⚫ }}
| Section4 = {{Chembox Thermochemistry
| DeltaHf = &minus;397.77 kJ/mol
| Entropy = 256.77 J&thinsp;K<sup>&minus;1</sup>&thinsp;mol<sup>&minus;1</sup>}}
| Section7 = {{Chembox Hazards | Section7 = {{Chembox Hazards
| ExternalMSDS = | ExternalMSDS = {{Dead link|date=May 2010}}
| EUIndex = 016-011-00-9 | EUIndex = 016-019-00-2
| EUClass = Corrosive ('''C''') | EUClass = ] ('''ox''')
| RPhrases = {{R20}}, {{R34}} | RPhrases = {{R14}}, {{R35}}, {{R37}}
| SPhrases = {{S1/2}}, {{S9}}, {{S26}}, {{S36/37/39}}, {{S45}} | SPhrases = {{S1/2}}, {{S26}}, {{S30}}, {{S45}}
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 3
| NFPA-O = OX
| FlashPt = Non-flammable | FlashPt = Non-flammable
| LD50 =
| LC50 = rat, 4hr 375 mg/m3
| PEL =
}} }}
| Section8 = {{Chembox Related | Section8 = {{Chembox Related
| OtherAnions =
⚫ | OtherCpds = ]<br/>]
| OtherCations = ]<br />]
| OtherFunctn = ]<br />]
| Function = ] ]s
| OtherCpds = ]
}} }}
}} }}

Revision as of 19:13, 9 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 469384763 of page Sulfur_trioxide with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Structure and dimensions of sulfur trioxide
Structure and dimensions of sulfur trioxide
Space-filling model of sulfur trioxide
Space-filling model of sulfur trioxide
Names
Preferred IUPAC name Sulfur trioxide
Systematic IUPAC name Sulfonylideneoxidane
Other names Sulfan
Sulfuric anhydride
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
EC Number
  • 231-197-3
Gmelin Reference 1448
PubChem CID
RTECS number
  • WT4830000
UN number UN 1829
InChI
  • InChI=1S/O3S/c1-4(2)3Key: AKEJUJNQAAGONA-UHFFFAOYSA-N
  • InChI=1S/O3S/c1-4(2)3Key: AKEJUJNQAAGONA-UHFFFAOYSA-N
  • InChI=1/O3S/c1-4(2)3Key: AKEJUJNQAAGONA-UHFFFAOYAX
SMILES
  • O=S(=O)=O
Properties
Chemical formula SO3
Molar mass 80.066 g/mol
Density 1.92 g/cm, liquid
Melting point 16.9 °C, 290.1 K, 62.4 °F
Boiling point 45 °C (113 °F; 318 K)
Solubility in water hydrolyses to Sulfuric Acid
Thermochemistry
Std molar
entropy (S298) 		256.77 J K mol
Std enthalpy of
formation (ΔfH298) 		−397.77 kJ/mol
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 3: Short exposure could cause serious temporary or residual injury. E.g. chlorine gasFlammability 0: Will not burn. E.g. waterInstability 3: Capable of detonation or explosive decomposition but requires a strong initiating source, must be heated under confinement before initiation, reacts explosively with water, or will detonate if severely shocked. E.g. hydrogen peroxideSpecial hazard OX: Oxidizer. E.g. potassium perchlorate
3 0 3OX
Flash point Non-flammable
Lethal dose or concentration (LD, LC):
LC50 (median concentration) rat, 4hr 375 mg/m3
Related compounds
Other cations Selenium trioxide
Tellurium trioxide
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic