Revision as of 14:47, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 441366144 of page Uridine_diphosphate_galactose for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 14:48, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 456532054 of page Uridine_diphosphate_glucose for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 402840143 |
|
| verifiedrevid = 442182436 |
|
|ImageFile=UDP-Galactose.svg |
|
| ImageFile = UDP-Glucose.svg |
|
|ImageSize= |
|
| ImageSize = 200px |
|
|IUPACName= |
|
|
|
| IUPACName = <nowiki>methoxy-hydroxyphosphoryl] hydrogen |
⚫ |
|OtherNames= |
|
|
|
phosphate |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = UDP-glucose |
|
| InChI = 1/C9H12N2O6.C6H14O12P2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;7-1-3(9)5(10)6(18-20(14,15)16)4(2-8)17-19(11,12)13/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);2-7,9-10H,1H2,(H2,11,12,13)(H2,14,15,16)/p-4/t4-,6-,7-,8-;3-,4+,5+,6-/m11/s1 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| InChIKey = UYLAOKYVSPTOGT-HUYLZDLQBS |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 8308 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 375951 |
|
|
| InChI = 1/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1 |
|
|
| InChIKey = HSCJRCZFDFQWRP-JZMIEXBBBU |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H12N2O6.C6H14O12P2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;7-1-3(9)5(10)6(18-20(14,15)16)4(2-8)17-19(11,12)13/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);2-7,9-10H,1H2,(H2,11,12,13)(H2,14,15,16)/p-4/t4-,6-,7-,8-;3-,4+,5+,6-/m11/s1 |
|
| StdInChI = 1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UYLAOKYVSPTOGT-UESRDHDISA-J |
|
| StdInChIKey = HSCJRCZFDFQWRP-JZMIEXBBSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 2956-16-3 --> |
|
|
|
| CASNo = 133-89-1 |
|
| PubChem=1166 |
|
| PubChem = 8629 |
|
| ChEMBL = <!-- blanked - oldvalue: 606038 --> |
|
|
|
| IUPHAR_ligand = 1783 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
⚫ |
| ChemSpiderID=19951534 |
|
|
|
| ChEBI = 52249 |
|
| SMILES = OC(O)(O)(OP()()=O)(C=O)OP()()=O.O=C\1NC(=O)N(/C=C/1)2O(CO)(O)2O |
|
| SMILES = O=P(O1O((O)(O)1O)CO)(O)OP(=O)(O)OC3O(N2/C=C\C(=O)NC2=O)(O)3O |
|
| MeSHName=Uridine+diphosphate+galactose |
|
| MeSHName = Uridine+Diphosphate+Glucose |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>24</sub>N<sub>2</sub>O<sub>17</sub>P<sub>2</sub> |
|
| Formula = C<sub>15</sub>H<sub>24</sub>N<sub>2</sub>O<sub>17</sub>P<sub>2</sub> |
|
| MolarMass=566.302 g/mol |
|
| MolarMass = 566.302 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| Solubility = |
|
| FlashPt= |
|
| MainHazards = |
|
| Autoignition= |
|
| FlashPt = |
|
|
| Autoignition = |
|
}} |
|
}} |
|
}} |
|
}} |