Revision as of 16:10, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 423264570 of page Wedelolactone for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit | Revision as of 16:13, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 456793387 of page Xamoterol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl| |
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{ |
{{Drugbox | ||
| Verifiedfields = changed | |||
| Watchedfields = changed | | Watchedfields = changed | ||
| verifiedrevid = |
| verifiedrevid = 410175973 | ||
| IUPAC_name = ''N''-(2-{amino}ethyl)morpholine-4-carboxamide | |||
|ImageFile=Wedelolactone.png | |||
| image = xamoterol.png | |||
|ImageSize=200px | |||
|IUPACName= 1,8,9-trihydroxy-3-methoxy-6H-benzofurochromen-6-one | |||
<!--Clinical data--> | |||
|OtherNames= | |||
| tradename = | |||
|Section1= {{Chembox Identifiers | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
⚫ | | |
||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
⚫ | | ChemSpiderID = |
||
| pregnancy_category = | |||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
⚫ | | CAS_number = <!-- blanked - oldvalue: 81801-12-9 --> | ||
| ATC_prefix = C01 | |||
| ATC_suffix = CX07 | |||
⚫ | | PubChem = 155774 | ||
| IUPHAR_ligand = 538 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
⚫ | | ChemSpiderID = 137213 | ||
| UNII_Ref = {{fdacite|changed|FDA}} | |||
| UNII = 7HE0JQL703 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| KEGG = |
| KEGG = D06328 | ||
| InChI = 1/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 | |||
| InChIKey = XQDCKJKKMFWXGB-UHFFFAOYAT | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| ChEMBL = |
| ChEMBL = 75753 | ||
<!--Chemical data--> | |||
| C=16 | H=25 | N=3 | O=5 | |||
| molecular_weight = 339.387 g/mol | |||
| smiles = O=C(NCCNCC(O)COc1ccc(O)cc1)N2CCOCC2 | |||
| InChI = 1/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | |||
| InChIKey = DXPOSRCHIDYWHW-UHFFFAOYAQ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/ |
| StdInChI = 1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = DXPOSRCHIDYWHW-UHFFFAOYSA-N | ||
⚫ | | |
||
⚫ | | |
||
| SMILES = O=C3Oc4cc(OC)cc(O)c4c2oc1c(cc(O)c(O)c1)c23 | |||
}} | |||
|Section2= {{Chembox Properties | |||
| Formula = C<sub>16</sub>H<sub>10</sub>O<sub>7</sub> | |||
| MolarMass= 314.24 g/mol | |||
| ExactMass = 314.042653 u | |||
| Appearance= | |||
| Density= | |||
| MeltingPt= | |||
| BoilingPt= | |||
| Solubility= | |||
}} | |||
|Section3= {{Chembox Hazards | |||
| MainHazards= | |||
| FlashPt= | |||
| Autoignition= | |||
}} | |||
}} | }} |
Revision as of 16:13, 10 January 2012
This page contains a copy of the infobox ({{drugbox}}) taken from revid 456793387 of page Xamoterol with values updated to verified values. |
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 410175973 | IUPAC_name = N-(2-{amino}ethyl)morpholine-4-carboxamide | image = xamoterol.png
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = | ATC_prefix = C01 | ATC_suffix = CX07 | PubChem = 155774 | IUPHAR_ligand = 538 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 137213 | UNII_Ref = | UNII = 7HE0JQL703 | KEGG_Ref = | KEGG = D06328 | ChEMBL_Ref = | ChEMBL = 75753
| C=16 | H=25 | N=3 | O=5 | molecular_weight = 339.387 g/mol | smiles = O=C(NCCNCC(O)COc1ccc(O)cc1)N2CCOCC2 | InChI = 1/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | InChIKey = DXPOSRCHIDYWHW-UHFFFAOYAQ | StdInChI_Ref = | StdInChI = 1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | StdInChIKey_Ref = | StdInChIKey = DXPOSRCHIDYWHW-UHFFFAOYSA-N }}