Revision as of 16:13, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{drugbox}} taken from revid 456793387 of page Xamoterol for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 16:14, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{chembox}} taken from revid 468365525 of page Xanthan_gum for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 448448006 |
|
| Watchedfields = changed |
|
|
|
| Reference = <ref name="carl-roth">{{cite web|url=http://www.carl-roth.de/jsp/de-de/sdpdf/3557.PDF |title=Sicherheitsdatenblatt des Herstellers Carl-Roth |format=PDF |date= |accessdate=2011-04-18}}</ref> |
⚫ |
| verifiedrevid = 410175973 |
|
|
|
| OtherNames = E 415 |
|
| IUPAC_name = ''N''-(2-{amino}ethyl)morpholine-4-carboxamide |
|
|
| image = xamoterol.png |
|
| ImageFile1 = Xanthan.svg |
|
|
| ImageSize1 = 320px |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
<!--Clinical data--> |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| tradename = |
|
|
|
| CASNo = 11138-66-2 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
⚫ |
| ChemSpiderID = NA |
|
| pregnancy_category = |
|
|
|
}} |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| Section2 = {{Chembox Properties |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| Formula = C<sub>35</sub>H<sub>49</sub>O<sub>29</sub> (monomer) |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
|
}} |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
|
| Section7 = {{Chembox Hazards |
|
| legal_status = |
|
|
|
| RPhrases = - |
|
| routes_of_administration = |
|
|
|
| SPhrases = - |
|
|
|
|
|
}} |
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 81801-12-9 --> |
|
|
| ATC_prefix = C01 |
|
|
| ATC_suffix = CX07 |
|
|
| PubChem = 155774 |
|
|
| IUPHAR_ligand = 538 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 137213 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 7HE0JQL703 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D06328 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 75753 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=16 | H=25 | N=3 | O=5 |
|
|
| molecular_weight = 339.387 g/mol |
|
|
| smiles = O=C(NCCNCC(O)COc1ccc(O)cc1)N2CCOCC2 |
|
|
| InChI = 1/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) |
|
|
| InChIKey = DXPOSRCHIDYWHW-UHFFFAOYAQ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = DXPOSRCHIDYWHW-UHFFFAOYSA-N |
|
|
}} |
|
}} |