Revision as of 16:30, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 435174135 of page Yttrium(III)_fluoride for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 16:31, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456598584 of page Zafirlukast for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 402887060 |
|
|
|
| Watchedfields = changed |
|
| Name = Yttrium(III) fluoride |
|
|
⚫ |
| verifiedrevid = 415866192 |
|
| ImageFile = Kristallstruktur Yttrium(III)-fluorid.png |
|
|
|
| IUPAC_name = cyclopentyl 3-{2-methoxy-4-benzyl}-1-methyl-1''H''-indol-5-ylcarbamate |
|
| ImageName = Yttrium(III) fluoride |
|
|
|
| image = Zafirlukast.svg |
|
| OtherNames = yttrium trifluoride |
|
|
|
| width = 250 |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| image2 = Zafirlukast 3D ball-and-stick.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = Accolate |
|
|
| Drugs.com = {{drugs.com|monograph|zafirlukast}} |
|
|
| MedlinePlus = a697007 |
|
|
| pregnancy_category = B1 <small>(Australia)</small>, B <small>(United States)</small> |
|
|
| legal_status = ] <small>(UK)</small> |
|
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = Unknown |
|
|
| protein_bound = 99% |
|
|
| metabolism = ] (]-mediated) |
|
|
| elimination_half-life = 10 hours |
|
|
| excretion = Biliary |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 107753-78-6 |
|
|
| ATC_prefix = R03 |
|
|
| ATC_suffix = DC01 |
|
⚫ |
| PubChem = 5717 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00549 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 75502 |
|
| ChemSpiderID = 5515 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/3FH.Y/h3*1H;/q;;;+3/p-3 |
|
|
|
| UNII = XZ629S5L50 |
|
| InChIKey = RBORBHYCVONNJH-DFZHHIFOAP |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| SMILES = F(F)F |
|
|
|
| KEGG = D00411 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 10100 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 603 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=31 | H=33 | N=3 | O=6 | S=1 |
|
|
| molecular_weight = 575.676 ]/] |
|
|
| smiles = O=S(=O)(c1ccccc1C)NC(=O)c2ccc(c(OC)c2)Cc4c3cc(ccc3n(c4)C)NC(=O)OC5CCCC5 |
|
|
| InChI = 1/C31H33N3O6S/c1-20-8-4-7-11-29(20)41(37,38)33-30(35)22-13-12-21(28(17-22)39-3)16-23-19-34(2)27-15-14-24(18-26(23)27)32-31(36)40-25-9-5-6-10-25/h4,7-8,11-15,17-19,25H,5-6,9-10,16H2,1-3H3,(H,32,36)(H,33,35) |
|
|
| InChIKey = YEEZWCHGZNKEEK-UHFFFAOYAR |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C31H33N3O6S/c1-20-8-4-7-11-29(20)41(37,38)33-30(35)22-13-12-21(28(17-22)39-3)16-23-19-34(2)27-15-14-24(18-26(23)27)32-31(36)40-25-9-5-6-10-25/h4,7-8,11-15,17-19,25H,5-6,9-10,16H2,1-3H3,(H,32,36)(H,33,35) |
|
| StdInChI = 1S/3FH.Y/h3*1H;/q;;;+3/p-3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RBORBHYCVONNJH-UHFFFAOYSA-K |
|
| StdInChIKey = YEEZWCHGZNKEEK-UHFFFAOYSA-N |
|
| CASNo = 13709-49-4 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| PubChem = 83679 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = YF<sub>3</sub> |
|
|
| MolarMass = 145.90 g mol<sup>−1</sup> |
|
|
| Appearance = white powder |
|
|
| Density = 4.01 g cm<sup>−3</sup> |
|
|
| Solubility = insoluble |
|
|
| Solvent = ] |
|
|
| SolubleOther = soluble |
|
|
| MeltingPtC = 1387 |
|
|
| BoilingPtC = 2230 |
|
|
| RefractIndex = 1.51 (500 nm) |
|
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| CrystalStruct = ], ], SpaceGroup = Pnma, No. 62 |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUIndex = Not listed |
|
|
| NFPA-H = |
|
|
| NFPA-R = |
|
|
| NFPA-F = |
|
|
| FlashPt = Non-flammable |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = ]<br/>]<br/>] |
|
|
| OtherCations = ]<br/>] |
|
|
}} |
|
|
}} |
|
}} |