Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 16:31, 10 January 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456828693 of page Zalutumumab for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit		Revision as of 16:31, 10 January 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 469931785 of page Zanamivir for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{Drugbox		{{Drugbox
	\| Verifiedfields = changed		\| Verifiedfields = changed
	\| verifiedrevid = ~~447746222~~		\| verifiedrevid = 423109522
			\| IUPAC_name = (2R,3R,4S)-4-guanidino-3-(prop-1-en-2-ylamino)-2-((1R,2R)-1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid
	\| image =		\| image = Zanamivir.png

	<!--Monoclonal antibody data-->
	\| type = mab
	\| mab_type = mab
	\| source = u
	\| target = ]

	<!--Clinical data-->		<!--Clinical data-->
	\| tradename =		\| tradename = Relenza
			\| Drugs.com = {{drugs.com\|monograph\|zanamivir}}
	\| pregnancy_AU =
			\| pregnancy_category = B1 (]), C (])
	\| pregnancy_US =
			\| legal_status = S4 <small>(Au)</small>, POM <small>(])</small>, ℞-only <small>(U.S.)</small>
	\| pregnancy_category =
		⚫	\| routes_of_administration = Inhalation
	\| legal_AU =
	\| legal_CA =
	\| legal_UK =
	\| legal_US =
	\| legal_status =
⚫	\| routes_of_administration =

	<!--Pharmacokinetic data-->		<!--Pharmacokinetic data-->
	\| bioavailability =		\| bioavailability = 2% (oral)
	\| protein_bound =		\| protein_bound = <10%
	\| metabolism =		\| metabolism = Negligible
	\| elimination_half-life =		\| elimination_half-life = 2.5–5.1 hours
	\| excretion =		\| excretion = Renal

	<!--Identifiers-->		<!--Identifiers-->
			\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| CAS_number_Ref = {{cascite\|correct\|??}}		\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| CAS_number = <!-- ~~blanked - oldvalue: 667901-13-5 -->~~		\| CAS_number = 139110-80-8
	\| ATC_prefix = ~~none~~		\| ATC_prefix = J05
	\| ATC_suffix =		\| ATC_suffix = AH01
	\| PubChem =		\| PubChem = 60855
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}		\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| DrugBank =		\| DrugBank = DB00558
	\| ChemSpiderID_Ref = {{chemspidercite\|~~changed~~\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = NA		\| ChemSpiderID = 54842
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
			\| UNII = L6O3XI777I
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
			\| KEGG = D00902
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
			\| ChEBI = 50663
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
			\| ChEMBL = 222813

	<!--Chemical data-->		<!--Chemical data-->
	\| C=~~6512~~ \| H=~~10074~~ \| N=~~1734~~ \| O=~~2032 \| S=46~~		\| C=12 \| H=20 \| N=4 \| O=7
	\| molecular_weight = ~~148~~ ]		\| molecular_weight = 332.31 g/mol
			\| smiles = O=C(O)C=1O((O)(O)CO)(NC(=O)C)(/N=C(\N)N)C=1
			\| InChI = 1/C12H20N4O7/c1-4(18)15-8-5(16-12(13)14)2-7(11(21)22)23-10(8)9(20)6(19)3-17/h2,5-6,8-10,17,19-20H,3H2,1H3,(H,15,18)(H,21,22)(H4,13,14,16)/t5-,6+,8+,9+,10+/m0/s1
			\| InChIKey = ARAIBEBZBOPLMB-UFGQHTETBS
			\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/C12H20N4O7/c1-4(18)15-8-5(16-12(13)14)2-7(11(21)22)23-10(8)9(20)6(19)3-17/h2,5-6,8-10,17,19-20H,3H2,1H3,(H,15,18)(H,21,22)(H4,13,14,16)/t5-,6+,8+,9+,10+/m0/s1
			\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChIKey = ARAIBEBZBOPLMB-UFGQHTETSA-N
			\| synonyms = <small>5-acetamido- 4-guanidino- 6-(1,2,3-trihydroxypropyl)- 5,6-dihydro- 4''H''-pyran- 2-carboxylic acid </small>
	}}		}}

Revision as of 16:31, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 469931785 of page Zanamivir with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data

Trade names	Relenza
Other names	5-acetamido- 4-guanidino- 6-(1,2,3-trihydroxypropyl)- 5,6-dihydro- 4H-pyran- 2-carboxylic acid
AHFS/Drugs.com	Monograph
Pregnancy category	B1 (Au), C (US)
Routes of administration	Inhalation
ATC code	J05AH01 (WHO)
Legal status
Legal status	S4 (Au), POM (UK), ℞-only (U.S.)
Pharmacokinetic data
Bioavailability	2% (oral)
Protein binding	<10%
Metabolism	Negligible
Elimination half-life	2.5–5.1 hours
Excretion	Renal
Identifiers
IUPAC name (2R,3R,4S)-4-guanidino-3-(prop-1-en-2-ylamino)-2-((1R,2R)-1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid
CAS Number	139110-80-8
PubChem CID	60855
DrugBank	DB00558
ChemSpider	54842
UNII	L6O3XI777I
KEGG	D00902
ChEBI	CHEBI:50663
ChEMBL	ChEMBL222813
Chemical and physical data
Formula	C₁₂H₂₀N₄O₇
Molar mass	332.31 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES O=C(O)C=1O((O)(O)CO)(NC(=O)C)(/N=C(\N)N)C=1
InChI InChI=1S/C12H20N4O7/c1-4(18)15-8-5(16-12(13)14)2-7(11(21)22)23-10(8)9(20)6(19)3-17/h2,5-6,8-10,17,19-20H,3H2,1H3,(H,15,18)(H,21,22)(H4,13,14,16)/t5-,6+,8+,9+,10+/m0/s1 Key:ARAIBEBZBOPLMB-UFGQHTETSA-N
(what is this?) (verify)