Revision as of 16:50, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,098 edits Saving copy of the {{drugbox}} taken from revid 477202531 of page 17-Hydroxypregnenolone for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 16:50, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,098 edits Saving copy of the {{drugbox}} taken from revid 462046002 of page 17-Hydroxyprogesterone for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 477189761 |
|
| verifiedrevid = 457308938 |
|
| IUPAC_name = 3β,17-dihydroxypregn-5-en-20-one |
|
| IUPAC_name = 17-Hydroxypregn-4-ene-3,20-dione |
|
| image = 17-Hydroxypregnenolone.svg |
|
|
| image2 = 17-Hidroxipregnenolona3D.png |
|
| image = 17-Hydroxyprogesterone.svg |
|
|
| image2 = 17-Hidroxiprogesterona3D.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| licence_US = Hydroxyprogesterone |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = B |
|
| pregnancy_category = |
|
| pregnancy_category = B |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = Rx-only |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = Intramuscular |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = ], ]s |
|
| metabolism = ] |
|
|
| elimination_half-life = 10 days (17-OHPC)<ref></ref> |
|
| elimination_half-life = |
|
|
| excretion = |
|
| excretion = |
|
|
|
|
Line 27: |
Line 30: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 387-79-1 |
|
| CAS_number = 68-96-2 |
|
| ATC_prefix = |
|
| ATC_prefix = G03 |
|
| ATC_suffix = |
|
| ATC_suffix = DA03 |
|
| PubChem = 3032570 |
|
| PubChem = 6238 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 17215939 |
|
| ChemSpiderID = 6002 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 21807M87J2 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 17252 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1062 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=21 | H=32 | O=3 |
|
| C=21 | H=30 | O=3 |
|
| molecular_weight = 332.48 g/mol |
|
| molecular_weight = 330.46 |
|
| smiles = CC2(O)CC13CCC4CC(O)C(=O)C4(C)3CC12C |
|
| smiles = O=C4\C=C2/(1CC3((O)(C(=O)C)CC31CC2)C)(C)CC4 |
|
| InChI = 1/C21H34O3/c1-4-21(24)10-8-16-14-6-5-13-11-17(22)18(23)12-19(13,2)15(14)7-9-20(16,21)3/h13-17,22,24H,4-12H2,1-3H3/t13?,14-,15+,16+,17?,19+,20+,21-/m1/s1 |
|
| InChI = 1/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
|
| InChIKey = QPLFSAZMHUAMKE-FOCOMJRBBT |
|
| InChIKey = DBPWSSGDRRHUNT-CEGNMAFCBF |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI = 1S/C21H34O3/c1-4-21(24)10-8-16-14-6-5-13-11-17(22)18(23)12-19(13,2)15(14)7-9-20(16,21)3/h13-17,22,24H,4-12H2,1-3H3/t13?,14-,15+,16+,17?,19+,20+,21-/m1/s1 |
|
| StdInChI = 1S/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey = QPLFSAZMHUAMKE-FOCOMJRBSA-N |
|
| StdInChIKey = DBPWSSGDRRHUNT-CEGNMAFCSA-N |
|
| melting_point = 268 |
|
| melting_point = 219.5 |
|
}} |
|
}} |