Revision as of 16:50, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,141 edits Saving copy of the {{drugbox}} taken from revid 462046002 of page 17-Hydroxyprogesterone for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 16:50, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,141 edits Saving copy of the {{chembox}} taken from revid 459645162 of page 17-N-Allylamino-17-demethoxygeldanamycin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 457308938 |
|
| verifiedrevid = 457644489 |
|
|
| Name=17-''N''-Allylamino-17-demethoxygeldanamycin |
|
| IUPAC_name = 17-Hydroxypregn-4-ene-3,20-dione |
|
|
|
| ImageFile = 17-N-Allylamino-17-demethoxygeldanamycin.svg |
|
| image = 17-Hydroxyprogesterone.svg |
|
|
|
| ImageSize = |
|
| image2 = 17-Hidroxiprogesterona3D.png |
|
|
|
| IUPACName = docosa-8,12,14,18,21-<br />pentaen-10-yl] carbamate |
|
|
|
|
|
| OtherNames = |
|
<!--Clinical data--> |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| tradename = |
|
|
|
| InChI = 1/C31H43N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,36H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1 |
|
| licence_US = Hydroxyprogesterone |
|
|
|
| InChIKey = AYUNIORJHRXIBJ-TXHRRWQRBY |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| SMILES1 = C1C(((/C=C(/((/C=C\C=C(\C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCC=C)/C)OC)OC(=O)N)\C)C)O)OC |
|
| pregnancy_US = B |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| pregnancy_category = B |
|
|
|
| StdInChI = 1S/C31H43N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,36H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1 |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| StdInChIKey = AYUNIORJHRXIBJ-TXHRRWQRSA-N |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
| legal_US = Rx-only |
|
|
|
| CASNo = <!-- blanked - oldvalue: 75747-14-7 --> |
|
| legal_status = |
|
|
⚫ |
| PubChem = 6440175 |
|
| routes_of_administration = Intramuscular |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
<!--Pharmacokinetic data--> |
|
|
⚫ |
| ChEMBL = 109480 |
|
| bioavailability = |
|
|
⚫ |
| ChemSpiderID = 21106220 |
|
| protein_bound = |
|
|
|
| SMILES = NC(=O)O1C(/C)=C/(C)(O)(OC)C(C)C\C2=C(/NCC=C)C(=O)\C=C(\NC(=O)C(\C)=C\C=C/1OC)C2=O |
|
| metabolism = ] |
|
|
|
}} |
|
| elimination_half-life = 10 days (17-OHPC)<ref></ref> |
|
|
|
| Section2 = {{Chembox Properties |
|
| excretion = |
|
|
|
| Formula = C<sub>31</sub>H<sub>43</sub>N<sub>3</sub>O<sub>8</sub> |
|
|
|
|
|
| MolarMass = 585.689 g/mol |
|
<!--Identifiers--> |
|
|
|
| Appearance = |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| Density = |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| MeltingPt = |
|
| CAS_number = 68-96-2 |
|
|
|
| BoilingPt = |
|
| ATC_prefix = G03 |
|
|
|
| Solubility = |
|
| ATC_suffix = DA03 |
|
|
|
}} |
⚫ |
| PubChem = 6238 |
|
|
|
| Section7 = {{Chembox Hazards |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
|
| MainHazards = |
|
| DrugBank = |
|
|
|
| FlashPt = |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| Autoignition = |
⚫ |
| ChemSpiderID = 6002 |
|
|
|
}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 21807M87J2 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 17252 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEMBL = 1062 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=21 | H=30 | O=3 |
|
|
| molecular_weight = 330.46 |
|
|
| smiles = O=C4\C=C2/(1CC3((O)(C(=O)C)CC31CC2)C)(C)CC4 |
|
|
| InChI = 1/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
|
|
| InChIKey = DBPWSSGDRRHUNT-CEGNMAFCBF |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
| StdInChIKey = DBPWSSGDRRHUNT-CEGNMAFCSA-N |
|
|
| melting_point = 219.5 |
|
|
}} |
|
}} |