Revision as of 19:48, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 447576927 of page Aceprometazine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 19:48, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 476653810 of page Acesulfame_potassium for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| verifiedrevid = 443364752 |
|
| verifiedrevid = 449102182 |
|
|
| ImageFile = AcesulfameK.svg |
|
| IUPAC_name = 1-{10--10''H''-phenothiazin-2-yl}ethanone |
|
|
|
| ImageSize = 200px |
|
| image = Aceprometazine.svg |
|
|
|
| ImageName = Acesulfame potassium |
|
|
|
|
|
| ImageFile1 = Acesulfame-k-ball-and-stick.png |
|
<!--Clinical data--> |
|
|
| tradename = |
|
| ImageSize1 = 200px |
|
|
| ImageName1 = Ball-and-stick model of acesulfame potassium |
|
| pregnancy_category = Contraindicated<br>Passes into ] |
|
|
|
| IUPACName = potassium 6-methyl-2,2-dioxo-2''H''-1,2λ<sup>6</sup>,3-oxathiazin-4-olate |
|
| legal_status = Rx-only |
|
|
|
| OtherNames = Acesulfame K |
|
| routes_of_administration = Oral |
|
|
|
Ace K |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
<!--Pharmacokinetic data--> |
|
|
|
| EINECS = 259-715-3 |
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = ] |
|
|
| elimination_half-life = |
|
|
| excretion = ] and fecal |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number = 13461-01-3 |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = 26035 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB01615 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 24249 |
|
| ChemSpiderID = 11262939 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 984N9YTM4Y |
|
| UNII = 23OV73Q5G9 |
|
|
| InChI = 1/C4H5NO4S.K/c1-3-2-4(6)5-10(7,8)9-3;/h2H,1H3,(H,5,6);/q;+1 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
⚫ |
| InChIKey = WBZFUFAFFUEMEI-UHFFFAOYAZ |
|
| ChEBI = 53770 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=19 | H=22 | N=2 | O=1 | S=1 |
|
|
| molecular_weight = 326.456 g/mol |
|
|
| smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CC(N(C)C)C)C |
|
|
| InChI = 1/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 |
|
⚫ |
| InChIKey = XLOQNFNTQIRSOX-UHFFFAOYAZ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 |
|
| StdInChI = 1S/C4H5NO4S.K/c1-3-2-4(6)5-10(7,8)9-3;/h2H,1H3,(H,5,6);/q;+1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XLOQNFNTQIRSOX-UHFFFAOYSA-N |
|
| StdInChIKey = WBZFUFAFFUEMEI-UHFFFAOYSA-N |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 55589-62-3 |
|
⚫ |
| PubChem = 23683747 |
|
|
| SMILES = .C\C1=C\C(=O)NS(=O)(=O)O1 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>4</sub>H<sub>4</sub>KNO<sub>4</sub>S |
|
|
| MolarMass = 201.242 |
|
|
| Appearance = white crystalline powder |
|
|
| Density = 1.81 g/cm<sup>3</sup> |
|
|
| MeltingPtC = 225 |
|
|
| BoilingPt = |
|
|
| Solubility = 270 g/L at 20 °C |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |