Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 20:02, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 464942404 of page Acrisorcin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit Revision as of 20:03, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 473525944 of page Acrivastine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
⚫ | verifiedrevid = 457803467
⚫ | image = Acrisorcin.png
| IUPAC_name = (''E'')-3-{6-pyridin-2-yl}prop-2-enoic acid
⚫ | verifiedrevid = 457803415
⚫ | image = Acrivastine.svg

⚫ <!--Combo data-->
| type = combo
| component1 = 9-Aminoacridine
| class1 =
| component2 = 4-Hexylresorcinol
| class2 = ]


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|international|acrivastine}}
| MedlinePlus = a682619
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = B
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = Rx-only
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | routes_of_administration = oral
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =
<!--Pharmacokinetic data-->
⚫ | routes_of_administration =
| elimination_half-life = 1.5 hours
| excretion = ]


<!--Identifiers--> <!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}} | CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 7527-91-5 --> | CAS_number = <!-- blanked - oldvalue: 87848-99-5 -->
| ATC_prefix = none | ATC_prefix = R06
| ATC_suffix = | ATC_suffix = AX18
| PubChem = 24144 | PubChem = 5284514
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22568 | ChemSpiderID = 4447574
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2U918O4BEV | UNII = A20F9XAI7W
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02759 | KEGG = D02760
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1201038 --> | ChEMBL = 1224

| smiles = Oc1cc(O)c(cc1)CCCCCC.n1c3c(c(c2c1cccc2)N)cccc3
⚫ <!--Chemical data-->
| InChI = 1/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3
| C=22 | H=24 | N=2 | O=2
| InChIKey = YZODJQFXMFEJRM-UHFFFAOYAT
| molecular_weight = 348.438 g/mol
| smiles = O=C(O)\C=C\c3nc(\C(=C\CN1CCCC1)c2ccc(cc2)C)ccc3
| InChI = 1/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+
| InChIKey = PWACSDKDOHSSQD-IUTFFREVBW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3 | StdInChI = 1S/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YZODJQFXMFEJRM-UHFFFAOYSA-N | StdInChIKey = PWACSDKDOHSSQD-IUTFFREVSA-N
}} }}

Revision as of 20:03, 16 February 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 473525944 of page Acrivastine with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 457803467 | IUPAC_name = (E)-3-{6-pyridin-2-yl}prop-2-enoic acid | image = Acrivastine.svg

| tradename = | Drugs.com = International Drug Names | MedlinePlus = a682619 | pregnancy_AU = | pregnancy_US = B | legal_AU = | legal_CA = | legal_UK = | legal_US = Rx-only | routes_of_administration = oral

| elimination_half-life = 1.5 hours | excretion = Renal

| CAS_number_Ref = | CAS_number = | ATC_prefix = R06 | ATC_suffix = AX18 | PubChem = 5284514 | DrugBank_Ref = | ChemSpiderID_Ref = | ChemSpiderID = 4447574 | UNII_Ref = | UNII = A20F9XAI7W | KEGG_Ref = | KEGG = D02760 | ChEMBL_Ref = | ChEMBL = 1224

| C=22 | H=24 | N=2 | O=2 | molecular_weight = 348.438 g/mol | smiles = O=C(O)\C=C\c3nc(\C(=C\CN1CCCC1)c2ccc(cc2)C)ccc3 | InChI = 1/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+ | InChIKey = PWACSDKDOHSSQD-IUTFFREVBW | StdInChI_Ref = | StdInChI = 1S/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+ | StdInChIKey_Ref = | StdInChIKey = PWACSDKDOHSSQD-IUTFFREVSA-N }}

Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic