| Revision as of 10:40, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464810689 of page 7-Methylguanosine for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo').← Previous edit |
Revision as of 10:42, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 460445418 of page A-366,833 for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
|
| verifiedrevid = 460444346 |
|
| ImageFile = 7-Methylguanosine.svg |
|
|
|
| IUPAC_name = 5-hept-6-yl]pyridine-3-carbonitrile |
|
| ImageSize = 180px |
|
|
|
| image = A-366833_structure.png |
|
| IUPACName = 7-Methylguanosine |
|
|
|
| width = 240 |
|
| OtherNames = N7-Methylguanosine; 2-Amino-1,6-dihydro-7-methyl-6-oxo-9-β-<small>D</small>-ribofuranosylpurinium |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
|
|
<!--Clinical data--> |
|
| Abbreviations = m7G; m<sup>7</sup>G |
|
|
|
| tradename = |
|
| CASNo = <!-- blanked - oldvalue: 20244-86-4 --> |
|
|
|
| routes_of_administration = |
| ⚫ |
| CASNo_Ref = {{cascite|correct|}} |
|
|
|
|
|
| ChEBI = 20794 |
|
|
|
<!--Identifiers--> |
| ⚫ |
| PubChem = 445404 |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
| ⚫ |
| ChemSpiderID = 393054 |
|
|
|
| CAS_number = |
|
| SMILES = O=C3/N=C(/N)Nc1c3n(c12O((O)2O)CO)C |
|
|
|
| ATC_suffix = |
|
| InChI = 1/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
|
|
| ChEMBL = 239931 |
|
| InChIKey = OGHAROSJZRTIOK-UJMNIJGGBX |
|
|
⚫ |
| PubChem = 9834234 |
|
| StdInChI = 1S/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| StdInChIKey = OGHAROSJZRTIOK-KQYNXXCUSA-O |
|
|
⚫ |
| ChemSpiderID = 8009955 |
|
}} |
|
|
|
| SMILES = N#Cc1cc(cnc1)N32CNC2C3 |
|
| Section2 = {{Chembox Properties |
|
|
|
| InChI = 1/C11H12N4/c12-2-8-1-10(5-13-3-8)15-7-9-4-14-6-11(9)15/h1,3,5,9,11,14H,4,6-7H2/t9-,11-/m0/s1 |
| ⚫ |
| C=11|H=16|N=5|O=5 |
|
|
|
| InChIKey = GPXAWLDGWSBLKM-ONGXEEELBH |
|
| Appearance = |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| Density = |
|
|
|
| StdInChI = 1S/C11H12N4/c12-2-8-1-10(5-13-3-8)15-7-9-4-14-6-11(9)15/h1,3,5,9,11,14H,4,6-7H2/t9-,11-/m0/s1 |
|
| MeltingPt = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| BoilingPt = |
|
|
⚫ |
| StdInChIKey = GPXAWLDGWSBLKM-ONGXEEELSA-N |
|
| Solubility = |
|
|
|
|
|
}} |
|
|
|
<!--Chemical data--> |
|
| Section3 = {{Chembox Hazards |
|
|
⚫ |
| C=11 | H=12 | N=4 |
|
| MainHazards = |
|
|
|
| molecular_weight = 200.239 |
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
|
}} |
|
}} |
