Revision as of 10:45, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 469716802 of page AM-087 for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 10:48, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 462745257 of page AMG-1 for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 462653342 |
|
| verifiedrevid = 424768477 |
|
| IUPAC_name = (6aR,10aR)-3-(2-methyl-6-bromohex-2-yl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzochromen-1-ol |
|
| IUPAC_name = (6aR,10aR)-3-(hept-1-ynyl)-6,6,9-trimethyl- |
|
| image = AM-087.png |
|
| image = AMG-1.png |
|
| width = 240 |
|
| width = 240 |
|
|
|
|
Line 17: |
Line 18: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = |
|
| CAS_number = |
|
| ChEMBL = 199561 |
|
| ChEMBL = 279147 |
|
| PubChem = 10717065 |
|
| PubChem = 10830874 |
|
⚫ |
| ChemSpiderID = 9006174 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| InChI = 1/C23H30O2/c1-5-6-7-8-9-10-17-14-20(24)22-18-13-16(2)11-12-19(18)23(3,4)25-21(22)15-17/h11,14-15,18-19,24H,5-8,12-13H2,1-4H3/t18-,19-/m1/s1 |
⚫ |
| ChemSpiderID = 8892405 |
|
|
|
| InChIKey = PYCLMAJRHLLHNO-RTBURBONBN |
⚫ |
| InChI = 1/C23H33BrO2/c1-15-8-9-18-17(12-15)21-19(25)13-16(14-20(21)26-23(18,4)5)22(2,3)10-6-7-11-24/h8,13-14,17-18,25H,6-7,9-12H2,1-5H3/t17-,18-/m1/s1 |
|
|
⚫ |
| StdInChI = 1S/C23H30O2/c1-5-6-7-8-9-10-17-14-20(24)22-18-13-16(2)11-12-19(18)23(3,4)25-21(22)15-17/h11,14-15,18-19,24H,5-8,12-13H2,1-4H3/t18-,19-/m1/s1 |
|
| InChIKey = RJPGJHLVEUSRRA-QZTJIDSGBN |
|
|
⚫ |
| StdInChIKey = PYCLMAJRHLLHNO-RTBURBONSA-N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C23H33BrO2/c1-15-8-9-18-17(12-15)21-19(25)13-16(14-20(21)26-23(18,4)5)22(2,3)10-6-7-11-24/h8,13-14,17-18,25H,6-7,9-12H2,1-5H3/t17-,18-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = RJPGJHLVEUSRRA-QZTJIDSGSA-N |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=33 | Br=1 | O=2 |
|
| C=23 | H=30 | O=2 |
|
| molecular_weight = 421.410 g/mol |
|
| molecular_weight = 338.482 g/mol |
|
| smiles = CC3(C)C1CC=C(C)CC1c2c(O)cc(C(C)(C)CCCCBr)cc2O3 |
|
| smiles = CC=3CC1c2c(O)cc(C#CCCCCC)cc2OC(C)(C)C1CC=3 |
|
}} |
|
}} |