| Revision as of 18:05, 8 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII', 'ChEBI').← Previous edit | Revision as of 18:16, 8 August 2011 edit undoCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_ChNext edit → | ||
| Line 1: | Line 1: | ||
| {{chembox | {{chembox | ||
| ⚫ | | verifiedrevid = 443718608 | ||
| | Verifiedfields = changed | |||
| ⚫ | | verifiedrevid = |
||
| |Reference=<ref> at ]</ref> | |Reference=<ref> at ]</ref> | ||
| |ImageFile=Ectoine structural formulae v.1.png | |ImageFile=Ectoine structural formulae v.1.png | ||
| Line 10: | Line 9: | ||
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| | ChemSpiderID = 112069 | | ChemSpiderID = 112069 | ||
| | KEGG_Ref = {{keggcite| |
| KEGG_Ref = {{keggcite|correct|kegg}} | ||
| | KEGG = C06231 | | KEGG = C06231 | ||
| | InChI = 1/C6H10N2O2/c1-4-7-3-2-5(8-4)6(9)10/h5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 | | InChI = 1/C6H10N2O2/c1-4-7-3-2-5(8-4)6(9)10/h5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 | ||
| Line 21: | Line 20: | ||
| | CASNo=96702-03-3 | | CASNo=96702-03-3 | ||
| | PubChem=126041 | | PubChem=126041 | ||
| | UNII_Ref = {{fdacite|correct|FDA}} | |||
| | |
| UNII = 7GXZ3858RY | ||
| | ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| | ChEBI = 27592 | | ChEBI = 27592 | ||
| | SMILES=CC1=NCCC(N1)C(=O)O | | SMILES=CC1=NCCC(N1)C(=O)O | ||
Revision as of 18:16, 8 August 2011
 | |
| Names | |
|---|---|
| IUPAC name (S)-2-methyl-3,4,5,6-tetrahydropyrimidine-4-carboxylic acid | |
| Other names THP(B) | |
| Identifiers | |
| CAS Number | |
| 3D model (JSmol) | |
| ChEBI | |
| ChemSpider | |
| KEGG | |
| PubChem CID | |
| UNII | |
| CompTox Dashboard (EPA) | |
InChI
| |
SMILES
| |
| Properties | |
| Chemical formula | C6H10N2O2 |
| Molar mass | 142.16 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa).
 Y verify (what is ?)
Infobox references
| |
Ectoine (1,4,5,6-Tetrahydro-2-methyl-4-pyrimidinecarboxylic acid) is a natural compound found in several species of bacteria. It is a compatible solute which serves as a protective substance by acting as an osmolyte and thus helps organisms survive extreme osmotic stress. Ectoine is found in high concentrations in halophilic microorganisms and confers resistance towards salt and temperature stress. Ectoine was first identified in the microorganism Ectothiorhodospira halochloris, but has since been found in a wide range of gram-negative and gram-positive bacteria. Some other species ectoine was found in:
Biosynthesis
Ectoine is synthesized in three successive enzymatic reactions starting from aspartic β-semialdehyde. The genes involved in the biosynthesis are called ectA, ectB and ectC and they encode the enzymes L-2,4-diaminobutyric acid acetyltransferase, L-2,4-diaminobutyric acid transaminase, and L-ectoine synthase respectively.
Use
Ectoine is used as an active ingredient in skin care and sun protection products. It stabilizes proteins and other cellular structures and protects the skin from stresses like UV irradiation and dryness.
References
.svg){kind=small} | This biochemistry article is a stub. You can help Misplaced Pages by expanding it. |