Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:04, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,098 edits Saving copy of the {{drugbox}} taken from revid 456543537 of page Famciclovir for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 12:06, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,098 edits Saving copy of the {{chembox}} taken from revid 455612937 of page Farnesol for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| Verifiedfields = changed
| verifiedrevid = 443750270 | verifiedrevid = 419646408
| IUPAC_name = 2--4-(2-amino-9''H''-purin-9-yl)butyl acetate
| Name = Farnesol
| image = Famciclovir structure.svg
| ImageFile = Farnesol.png

| ImageSize = 250px
<!--Clinical data-->
| ImageName = Skeletal formula of farnesol
| tradename = Famvir
| ImageFile1 = Farnesol-3D-balls.png
| Drugs.com = {{drugs.com|monograph|famciclovir}}
| MedlinePlus = a694038 | ImageSize1 = 250px
| ImageName1 = Ball-and-stick model
| pregnancy_category = B1 <small>(])</small>, B <small>(])</small>
| IUPACName = (2''E'',6''E'')-3,7,11-trimethyldodeca-2,6,10-trien-1-ol
| legal_status = S4 <small>(Au)</small>, POM <small>(])</small>, ℞-only <small>(U.S.)</small>
| Section1 = {{Chembox Identifiers
| routes_of_administration = Oral
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

⚫ | ChemSpiderID = 3210
<!--Pharmacokinetic data-->
⚫ | PubChem = 3327
| bioavailability = 75–77%
⚫ | ChEMBL_Ref = {{ebicite|changed|EBI}}
| protein_bound = 20-25%
| ChEMBL = <!-- blanked - oldvalue: 25308 -->
| metabolism = Hepatic, circulation, intestinal wall (to ])
| elimination_half-life = 2–2.3 hours
| excretion = Renal, faecal

<!--Identifiers-->
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 104227-87-4
| ATC_prefix = J05
| ATC_suffix = AB09
| ATC_supplemental = {{ATC|S01|AD07}}
⚫ | PubChem = 3324
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank = DB00426
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 3207
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QIC03ANI02 | UNII = X23PI60R17
| InChI = 1/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChIKey = CRDAMVZIKSXKFV-UHFFFAOYAI
⚫ | KEGG = D00317
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChEBI = 4974
⚫ | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 880

<!--Chemical data-->
⚫ | C=14 | H=19 | N=5 | O=4
| molecular_weight = 321.332 g/mol
| smiles = O=C(OCC(COC(=O)C)CCn1c2nc(ncc2nc1)N)C
| InChI = 1/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18)
| InChIKey = GGXKWVWZWMLJEH-UHFFFAOYAH
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) | StdInChI = 1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GGXKWVWZWMLJEH-UHFFFAOYSA-N | StdInChIKey = CRDAMVZIKSXKFV-UHFFFAOYSA-N
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| melting_point = 103
| CASNo = 4602-84-0
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
⚫ | KEGG = C01493
⚫ | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
⚫ | DrugBank = DB02509
⚫ | ChEBI_Ref = {{ebicite|changed|EBI}}
⚫ | ChEBI = 28600
| SMILES = OCC=C(CCC=C(CC\C=C(/C)C)C)C
}}
| Section2 = {{Chembox Properties
⚫ | C = 15 | H = 26 | O = 1
| MolarMass = 222.37 g/mol
| Density = 0.887 g/cm<sup>3</sup>
| MeltingPt =
| BoilingPt = 111 °C at 0.35 mmHg<br>283-284.00 °C at 760 mmHg
}}
}} }}

Revision as of 12:06, 17 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 455612937 of page Farnesol with values updated to verified values.
Farnesol
Skeletal formula of farnesol
Skeletal formula of farnesol
Ball-and-stick model
Ball-and-stick model
Names
IUPAC name (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
DrugBank
KEGG
PubChem CID
UNII
InChI
  • InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3Key: CRDAMVZIKSXKFV-UHFFFAOYSA-N
  • InChI=1/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3Key: CRDAMVZIKSXKFV-UHFFFAOYAI
SMILES
  • OCC=C(CCC=C(CC\C=C(/C)C)C)C
Properties
Chemical formula C15H26O
Molar mass 222.37 g/mol
Density 0.887 g/cm
Boiling point 111 °C at 0.35 mmHg
283-284.00 °C at 760 mmHg
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic