Revision as of 09:27, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 461710360 of page Miconazole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 09:28, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 461705756 of page Methanandamide for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Chembox |
|
⚫ |
| verifiedrevid = 408592062 |
|
| Verifiedfields = changed |
|
|
|
| ImageFile = Methanandamide.svg |
⚫ |
| verifiedrevid = 411361909 |
|
|
⚫ |
| ImageSize = 200px |
|
| IUPAC_name = (''RS'')-1-(2-(2,4-Dichlorobenzyloxy)-2-(2,4-dichlorophenyl)ethyl)-1''H''-imidazole |
|
|
|
| IUPACName = (5''Z'',8''Z'',11''Z'',14''Z'')-''N''-icosa-5,8,11,14-tetraenamide |
|
| image = Miconazole structure.png |
|
|
|
| OtherNames = AM-356; Arachidonyl-1'-hydroxy-2'-propylamide |
⚫ |
| width = 200px |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
|
| CASNo = <!-- blanked - oldvalue: 157182-49-5 --> |
|
| drug_name = Miconazole |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
|
⚫ |
| PubChem = 6321351 |
|
<!--Clinical data--> |
|
|
⚫ |
| ChemSpiderID = 4881984 |
|
| tradename = Monistat |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Drugs.com = {{drugs.com|monograph|miconazole-nitrate}} |
|
|
|
| SMILES = O=C(N(C)CO)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC |
|
| MedlinePlus = a601203 |
|
|
|
| InChI = InChI=1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(26)24-22(2)21-25/h7-8,10-11,13-14,16-17,22,25H,3-6,9,12,15,18-21H2,1-2H3,(H,24,26)/b8-7-,11-10-,14-13-,17-16-/t22-/m1/s1 |
|
| pregnancy_category = |
|
|
|
| InChIKey = SQKRUBZPTNJQEM-FQPARAGTBH |
|
| legal_UK = POM |
|
|
| legal_US = OTC |
|
|
| legal_status = |
|
|
| routes_of_administration = ], ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = n/a |
|
|
| metabolism = n/a |
|
|
| elimination_half-life = n/a |
|
|
| excretion = n/a |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 22916-47-8 |
|
|
| ATC_prefix = D01 |
|
|
| ATC_suffix = AC02 |
|
|
| ATC_supplemental = {{ATC|A01|AB09}} {{ATC|A07|AC01}} {{ATC|G01|AF04}} |
|
⚫ |
| PubChem = 4189 |
|
|
| IUPHAR_ligand = 2449 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB01110 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4044 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 7NNO0D7S5M |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00416 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 6923 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 91 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=18 | H=14 | Cl=4 | N=2 | O=1 |
|
|
| molecular_weight = 416.127 g/mol |
|
|
| smiles = Clc1ccc(c(Cl)c1)C(OCc2ccc(Cl)cc2Cl)Cn3ccnc3 |
|
|
| InChI = 1/C18H14Cl4N2O/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22/h1-8,11,18H,9-10H2 |
|
|
| InChIKey = BYBLEWFAAKGYCD-UHFFFAOYAA |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H14Cl4N2O/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22/h1-8,11,18H,9-10H2 |
|
| StdInChI = 1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(26)24-22(2)21-25/h7-8,10-11,13-14,16-17,22,25H,3-6,9,12,15,18-21H2,1-2H3,(H,24,26)/b8-7-,11-10-,14-13-,17-16-/t22-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BYBLEWFAAKGYCD-UHFFFAOYSA-N |
|
| StdInChIKey = SQKRUBZPTNJQEM-FQPARAGTSA-N |
|
⚫ |
| ChEMBL = 120526 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
⚫ |
| C=23 | H=39 | N=1 | O=2 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |