Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:07, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 456594528 of page Nitrofurantoin for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 14:07, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 456630303 of page Nitrofurazone for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 408771593 | verifiedrevid = 440912283
| IUPAC_name = (''E'')-1-imidazolidine-2,4-dione
| IUPAC_name = 5-nitro-2-furaldehyde semicarbazone
| image = nitrofurantoin.png | image = Nitrofurazone.png


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|monograph|nitrofurantoin}} | Drugs.com = {{drugs.com|CONS|nitrofurazone}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| MedlinePlus = a682291
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = B | pregnancy_category =
⚫ | legal_status = Rx, PoM
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| routes_of_administration = oral, rectal<ref name="parrott1976">{{Cite doi | 10.1002/jps.2600660713}}</ref>
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status =
| routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 40% | bioavailability =
| metabolism = liver (75%) | protein_bound =
| metabolism =
| elimination_half-life = 20 minutes | elimination_half-life =
| excretion = urine and bile | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 67-20-9 | CAS_number = 59-87-0
| ATC_prefix = J01 | CAS_supplemental =
| ATC_suffix = XE01 | ATC_prefix = B05
| PubChem = 6604200 | ATC_suffix = CA03
| ATC_supplemental = {{ATC|D08|AF01}} {{ATC|D09|AA03}} {{ATC|P01|CC02}} {{ATC|S01|AX04}} {{ATC|S02|AA02}} {{ATCvet|G01|AX90}} {{ATCvet|P51|AC02}}
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00698 | PubChem = 5447130
⚫ | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00336
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5036498 | ChemSpiderID = 4566720
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 927AH8112L | UNII = X8XI70B5Z6
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00439 | KEGG = D00862
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 572 | ChEMBL = 869


<!--Chemical data--> <!--Chemical data-->
| chemical_formula =
| C=8 | H=6 | N=4 | O=5 | C=6 | H=6 | N=4 | O=4
| molecular_weight = 238.16 | molecular_weight = 198.14 g/mol
| smiles = O=()c2oc(/C=N/N1C(=O)NC(=O)C1)cc2 | smiles = O=()c1oc(/C=N/NC(=O)N)cc1
| InChI = 1/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ | InChI = 1/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+
| InChIKey = NXFQHRVNIOXGAQ-YCRREMRBBU
| InChIKey = IAIWVQXQOWNYOU-FPYGCLRLBW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ | StdInChI = 1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NXFQHRVNIOXGAQ-YCRREMRBSA-N | StdInChIKey = IAIWVQXQOWNYOU-FPYGCLRLSA-N
}} }}

Revision as of 14:07, 24 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456630303 of page Nitrofurazone with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comMicromedex Detailed Consumer Information
ATC code
Identifiers
IUPAC name
  • 5-nitro-2-furaldehyde semicarbazone
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC6H6N4O4
Molar mass198.14 g/mol g·mol
3D model (JSmol)
SMILES
  • O=()c1oc(/C=N/NC(=O)N)cc1
InChI
  • InChI=1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+
  • Key:IAIWVQXQOWNYOU-FPYGCLRLSA-N
  (what is this?)  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic