Revision as of 15:54, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456539027 of page Parecoxib for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 15:54, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456635836 of page Paromomycin_sulfate for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 400842138 |
|
| verifiedrevid = 400842250 |
|
|
| IUPAC_name = (2''R'',3''S'',4''R'',5''R'',6''S'')-5-amino-6-<br>oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-<br>3-hydroxy-cyclohexyl]oxy-2-(hydroxymethyl)oxane-3,4-diol |
|
| IUPAC_name = ''N''-{<br />sulfonyl}propanamide |
|
|
| image = Parecoxib.svg |
|
| image = Paromomycin structure.svg |
|
|
| width = 300 |
|
|
| drug_name = Paromomycin |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|parecoxib}} |
|
| Drugs.com = {{drugs.com|monograph|paromomycin-sulfate}} |
|
| licence_EU = Dynastat |
|
| MedlinePlus = a601098 |
|
|
| pregnancy_US = B |
|
| pregnancy_category = Not recommended |
|
|
|
| legal_status = Rx only <small>]</small> |
|
| legal_UK = POM |
|
|
| routes_of_administration = ] and ] |
|
| routes_of_administration = Oral, ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 100% |
|
| bioavailability = None |
|
| protein_bound = 98% |
|
| metabolism = None |
|
|
| elimination_half-life = ? |
|
| metabolism = ] to ] and ]<br />] extensively involved (mainly ] and ]) |
|
|
|
| excretion = Fecal |
|
| elimination_half-life = 22 minutes (parecoxib)<br />8 hours (valdecoxib) |
|
|
| excretion = ] (70%, metabolites) |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 202409-33-4 |
|
| CAS_number = 1263-89-4 |
|
| ATC_prefix = M01 |
|
| ATC_prefix = A07 |
|
| ATC_suffix = AH04 |
|
| ATC_suffix = AA06 |
|
| PubChem = 119828 |
|
| PubChem = 441375 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank = DB08439 |
|
| DrugBank = DB01421 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 106990 |
|
| ChemSpiderID = 390117 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 9TUW81Y3CE |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1206690 --> |
|
| ChEMBL = <!-- blanked - oldvalue: 370143 --> |
|
| C=19 | H=18 | N=2 | O=4 | S=1 |
|
| C=23 | H=47 | N=5 | O=18 | S=1 |
|
| molecular_weight = 370.422 g/mol |
|
| molecular_weight = 615.629 g/mol |
|
|
| smiles = O=S(=O)(O)O.O(3(O2O(CO)(O1O(CN)(O)(O)1N)2O)(O)(N)C3N)4O((O)(O)4N)CO |
|
| smiles = O=C(NS(=O)(=O)c3ccc(c2c(onc2c1ccccc1)C)cc3)CC |
|
|
| InChI = 1/C19H18N2O4S/c1-3-17(22)21-26(23,24)16-11-9-14(10-12-16)18-13(2)25-20-19(18)15-7-5-4-6-8-15/h4-12H,3H2,1-2H3,(H,21,22) |
|
| InChI = 1/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1 |
|
| InChIKey = TZRHLKRLEZJVIJ-UHFFFAOYAA |
|
| InChIKey = LJRDOKAZOAKLDU-UDXJMMFXBW |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H18N2O4S/c1-3-17(22)21-26(23,24)16-11-9-14(10-12-16)18-13(2)25-20-19(18)15-7-5-4-6-8-15/h4-12H,3H2,1-2H3,(H,21,22) |
|
| StdInChI = 1S/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = TZRHLKRLEZJVIJ-UHFFFAOYSA-N |
|
| StdInChIKey = LJRDOKAZOAKLDU-UDXJMMFXSA-N |
|
}} |
|
}} |