Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 13:06, 5 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 417928399 of page Pifithrin for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 13:06, 5 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 462917721 of page Pilocarpine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~chembox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~chembox~~		{{Drugbox
			\| Verifiedfields = changed
	\| verifiedrevid = ~~417927422~~		\| verifiedrevid = 412575930
	\| Name = Pifithrin
			\| IUPAC_name = (3''S'',4''R'')- 3-ethyl- 4-((1-methyl- 1''H''-imidazol- 5-yl) methyl)dihydrofuran- 2(3''H'')-one
	\| ImageFile = Pifithrin.PNG
			\| image = Pilocarpine Structural Formulae.png
	<!-- \| ImageSize = 200px -->

	\| ImageName =
			<!--Clinical data-->
	\| IUPACName = 2-amino-3--2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-ylium bromide
			\| tradename = Salagen
	\| Section1 = {{Chembox Identifiers
			\| Drugs.com = {{drugs.com\|monograph\|pilocarpine}}
	\| InChI = 1/C16H19N2OS.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9H,2-5,10,17H2,1H3;1H/q+1;/p-1
			\| MedlinePlus = a608039
	\| InChIKey = KXMMOFYVZLFBEG-REWHXWOFAW
			\| pregnancy_category = C
			\| legal_US = Rx-only
			\| routes_of_administration = ], ]

			<!--Pharmacokinetic data-->
			\| bioavailability =
			\| protein_bound =
			\| metabolism =
			\| elimination_half-life = {{Reference necessary\|1=0.76 hours (5 mg), 1.35 hours (10 mg)\|date=April 2011}}
			\| excretion = urine

			<!--Identifiers-->
			\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CAS_number_Ref = {{cascite\|correct\|??}}
			\| CAS_number = 92-13-7
			\| CAS_supplemental = <br/>54-71-7 (hydrochloride) <!-- Also CAS verified -->
			\| ATC_prefix = N07
			\| ATC_suffix = AX01
			\| ATC_supplemental = {{ATC\|S01\|EB01}}
			\| PubChem = 5910
			\| IUPHAR_ligand = 305
			\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
			\| DrugBank = DB01085
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 5699
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
			\| UNII = 01MI4Q9DI3
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
			\| KEGG = D00525
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
			\| ChEBI = 8207
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}		\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ChEMBL = ~~556353~~		\| ChEMBL = 550

			<!--Chemical data-->
			\| C=11 \| H=16 \| N=2 \| O=2
			\| molecular_weight = 208.257 g/mol
			\| smiles = O=C2OC(Cc1n(cnc1)C)2CC
			\| InChI = 1/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1
			\| InChIKey = QCHFTSOMWOSFHM-WPRPVWTQBQ
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C16H18N2OS.BrH~~/c1-11-6-8~~-12~~(9-7-11)14~~(19~~)~~10-18-13-~~4-~~2-3~~-5-~~15(13)20~~-16(18)~~17;~~/h6-9,~~17H~~,2-5,~~10H2~~,~~1H3;1H~~		\| StdInChI = 1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~HAGVCKULCLQGRF~~-~~UHFFFAOYSA~~-N		\| StdInChIKey = QCHFTSOMWOSFHM-WPRPVWTQSA-N
	\| CASNo =
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
⚫	\| ChemSpiderID=~~21106463~~
	\| SMILES = .Cc1ccc(cc1)C(=O)Cn2(N)sc3CCCCc23
	}}
	\| Section2 = {{Chembox Properties
	\| Formula = C<sub>16</sub>H<sub>19</sub>BrN<sub>2</sub>OS
	\| MolarMass = 367.30 g/mol
	\| Density =
	\| MeltingPt = 192.1 °C
	\| BoilingPt =
	}}
	}}		}}

Revision as of 13:06, 5 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 462917721 of page Pilocarpine with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data

Trade names	Salagen
AHFS/Drugs.com	Monograph
MedlinePlus	a608039
Pregnancy category	C
Routes of administration	gtts, p.o.
ATC code	N07AX01 (WHO) S01EB01 (WHO)
Legal status
Legal status	US: ℞-only
Pharmacokinetic data
Elimination half-life
Excretion	urine
Identifiers
IUPAC name (3S,4R)- 3-ethyl- 4-((1-methyl- 1H-imidazol- 5-yl) methyl)dihydrofuran- 2(3H)-one
CAS Number	92-13-7 54-71-7 (hydrochloride)
PubChem CID	5910
IUPHAR/BPS	305
DrugBank	DB01085
ChemSpider	5699
UNII	01MI4Q9DI3
KEGG	D00525
ChEBI	CHEBI:8207
ChEMBL	ChEMBL550
Chemical and physical data
Formula	C₁₁H₁₆N₂O₂
Molar mass	208.257 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES O=C2OC(Cc1n(cnc1)C)2CC
InChI InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1 Key:QCHFTSOMWOSFHM-WPRPVWTQSA-N
(what is this?) (verify)