Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:31, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 458681834 of page Propanoic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 14:31, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456800582 of page Propantheline_bromide for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 457781575 | verifiedrevid = 456483224
| Name = Propanoic acid
| IUPAC_name = ''N''-isopropyl-''N''-methyl-''N''-{2-ethyl}propan-2-aminium bromide
| ImageFileL1 = Propionic_acid_chemical_structure.png
| image = Proprantheline bromide.svg
| ImageSizeL1 = 140px

| ImageNameL1 = Simplified skeletal formula
<!--Clinical data-->
| ImageFileR1 = Propionic_acid_flat_structure.png
| tradename =
| ImageNameR1 = Full structural formula
| Drugs.com = {{drugs.com|monograph|propantheline_bromide}}
| ImageSizeR1 = 150px
| MedlinePlus = a684020
| ImageFileL2 = Propionic-acid-3D-balls.png
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ImageSizeL2 = 135px
| pregnancy_US = <!-- A / B / C / D / X -->
| ImageNameL2 = Ball-and-stick model
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| ImageFileR2 = Propionic acid spheres.png
| legal_UK = <!-- GSL / P / POM / CD -->
| ImageNameR2 = Space-filling model
| legal_US = <!-- OTC / Rx-only -->
| ImageSizeR2 = 120px

| IUPACName = propanoic acid
<!--Identifiers-->
| OtherNames = ethanecarboxylic acid, propionic acid
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| Section1 = {{Chembox Identifiers
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | CAS_number_Ref = {{cascite|correct|??}}
| DrugBank = DB03766 | CAS_number = 298-50-0
| ChEBI_Ref = {{ebicite|correct|EBI}} | CAS_supplemental = {{CAS|50-34-0}}
| ChEBI = 30768 | ATC_prefix = A03
| SMILES = CCC(=O)O | ATC_suffix = AB05
| CASNo = 79-09-4 | PubChem = 9279
| CASNo_Ref = {{cascite|correct|CAS}} | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = <!-- blanked - oldvalue: APRD00177 -->
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 8922
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1306V2B0Q8
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 14021 | ChEMBL = 1240

| PubChem = 1032
<!--Chemical data-->
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| C=23 | H=30 | N=1 | O=3
⚫ | ChemSpiderID = 1005
| molecular_weight = 368.489 g/mol
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| smiles = .O=C(OCC(C(C)C)(C(C)C)C)C2c3c(Oc1c2cccc1)cccc3
| DrugBank = DB03766
| InChI = 1/C23H30NO3.BrH/c1-16(2)24(5,17(3)4)14-15-26-23(25)22-18-10-6-8-12-20(18)27-21-13-9-7-11-19(21)22;/h6-13,16-17,22H,14-15H2,1-5H3;1H/q+1;/p-1
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
| InChIKey = XLBIBBZXLMYSFF-REWHXWOFAD
| ChEBI = 30768
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| SMILES = CCC(=O)O
| StdInChI = 1S/C23H30NO3.BrH/c1-16(2)24(5,17(3)4)14-15-26-23(25)22-18-10-6-8-12-20(18)27-21-13-9-7-11-19(21)22;/h6-13,16-17,22H,14-15H2,1-5H3;1H/q+1;/p-1
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)
⚫ | StdInChIKey = XLBIBBZXLMYSFF-UHFFFAOYSA-M
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = XBDQKXXYIPTUBI-UHFFFAOYSA-N
| RTECS = UE5950000
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>3</sub>H<sub>6</sub>O<sub>2</sub>
| MolarMass = 74.08 g/mol
| Appearance = colourless liquid
| Density = 0.99 g/cm³
| Solubility = miscible
| MeltingPtC = −21
| BoilingPtC = 141
| pKa = 4.87
| Viscosity = 10 ]
}}
| Section3 = {{Chembox Structure
| Dipole = 0.63 ]
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS = ]
| MainHazards = Corrosive
| NFPA-H = 3
| NFPA-F = 2
| NFPA-R =
| FlashPt = 327 K, 54 °C
| RPhrases = {{R34}}
| SPhrases = {{S1/2}} {{S23}} {{S36}} {{S45}}
}}
| Section8 = {{Chembox Related
| OtherAnions = ]
| Function = ]s
| OtherFunctn = ]</br>]</br>]</br>]</br>]</br>]
| OtherCpds = ]</br>]</br>]</br>]}}
}} }}

Revision as of 14:31, 5 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456800582 of page Propantheline_bromide with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 456483224 | IUPAC_name = N-isopropyl-N-methyl-N-{2-ethyl}propan-2-aminium bromide | image = Proprantheline bromide.svg

| tradename = | Drugs.com = Monograph | MedlinePlus = a684020 | pregnancy_AU = | pregnancy_US = | legal_AU = | legal_UK = | legal_US =

| CASNo_Ref = | CAS_number_Ref = | CAS_number = 298-50-0 | CAS_supplemental = 50-34-0 | ATC_prefix = A03 | ATC_suffix = AB05 | PubChem = 9279 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 8922 | UNII_Ref = | UNII = 1306V2B0Q8 | ChEMBL_Ref = | ChEMBL = 1240

| C=23 | H=30 | N=1 | O=3 | molecular_weight = 368.489 g/mol | smiles = .O=C(OCC(C(C)C)(C(C)C)C)C2c3c(Oc1c2cccc1)cccc3 | InChI = 1/C23H30NO3.BrH/c1-16(2)24(5,17(3)4)14-15-26-23(25)22-18-10-6-8-12-20(18)27-21-13-9-7-11-19(21)22;/h6-13,16-17,22H,14-15H2,1-5H3;1H/q+1;/p-1 | InChIKey = XLBIBBZXLMYSFF-REWHXWOFAD | StdInChI_Ref = | StdInChI = 1S/C23H30NO3.BrH/c1-16(2)24(5,17(3)4)14-15-26-23(25)22-18-10-6-8-12-20(18)27-21-13-9-7-11-19(21)22;/h6-13,16-17,22H,14-15H2,1-5H3;1H/q+1;/p-1 | StdInChIKey_Ref = | StdInChIKey = XLBIBBZXLMYSFF-UHFFFAOYSA-M }}

Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic