| Revision as of 13:38, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 451727350 of page Sameridine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 13:38, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 447547117 of page Sanguinarine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 447992923 |
|
| verifiedrevid = 444095870 |
|
| IUPAC_name = N-ethyl-1-hexyl-N-methyl-4-phenylpiperidine-4-carboxamide |
|
| IUPAC_name = 13-Methyl-benzodioxolo-1,3-dioxolophenanthridinium |
|
| image = Sameridine.svg |
|
| image = sanguinarine structure.png |
|
| width = 160 |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 12: |
Line 11: |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- Schedule I --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = |
|
|
| legal_status = |
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 25: |
Line 25: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number = <!-- blanked - oldvalue: 143257-97-0 --> |
|
| CAS_number = <!-- blanked - oldvalue: 2447-54-3 --> |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 65996 |
|
| ChEMBL = 417799 |
|
|
| PubChem = 5154 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 59388 |
|
| ChemSpiderID = 4970 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = NQP2Y50Y6B |
|
| UNII = AV9VK043SS |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 17183 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=21 | H=34 | N=2 | O=1 |
|
| C=20 | H=14 | N=1 | O=4 |
|
| molecular_weight = 330.51 g/mol |
|
| molecular_weight = 332.09 |
|
| smiles = O=C(N(CC)C)C2(c1ccccc1)CCN(CCCCCC)CC2 |
|
| smiles = O1c3c(OC1)c2c(c5c(c2cc3)ccc6cc4OCOc4cc56)C |
|
| InChI = 1/C21H34N2O/c1-4-6-7-11-16-23-17-14-21(15-18-23,20(24)22(3)5-2)19-12-9-8-10-13-19/h8-10,12-13H,4-7,11,14-18H2,1-3H3 |
|
| InChI = 1/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
|
| InChIKey = TYWUGCGYWNSRPS-UHFFFAOYAH |
|
| InChIKey = INVGWHRKADIJHF-UHFFFAOYAZ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H34N2O/c1-4-6-7-11-16-23-17-14-21(15-18-23,20(24)22(3)5-2)19-12-9-8-10-13-19/h8-10,12-13H,4-7,11,14-18H2,1-3H3 |
|
| StdInChI = 1S/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = TYWUGCGYWNSRPS-UHFFFAOYSA-N |
|
| StdInChIKey = INVGWHRKADIJHF-UHFFFAOYSA-N |
|
| synonyms = |
|
|
}} |
|
}} |
