Revision as of 18:32, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 444253987 of page TATB for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 18:33, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 465416710 of page TEMPO for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 414618644 |
|
| verifiedrevid = 438232835 |
|
|
| Name = TEMPO |
|
| ImageFile = Triaminotrinitrobenzene.png |
|
|
|
| OtherNames = (2,2,6,6-Tetramethyl-piperidin-1-yl)oxyl |
|
| ImageFile1 = TATB-3D-vdW.png |
|
|
|
| ImageFile = 2,2,6,6-Tetramethylpiperidinyloxyl.svg |
|
| ImageSize = 150px |
|
|
| IUPACName = 1,3,5-triamino-2,4,6-trinitrobenzene |
|
|
| OtherNames = |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 2564-83-2 |
|
| ChemSpiderID = 17272 |
|
|
|
| RTECS = TN8991900 |
|
| InChI = 1/C6H6N6O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16/h7-9H2 |
|
|
⚫ |
}} |
|
| InChIKey = JDFUJAMTCCQARF-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C6H6N6O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16/h7-9H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = JDFUJAMTCCQARF-UHFFFAOYSA-N |
|
|
| CASNo = <!-- blanked - oldvalue: 3058-38-6 --> |
|
|
| PubChem = 18286 |
|
|
| SMILES = c1(c(c(c(c(c1(=O))N)(=O))N)(=O))N |
|
⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>9</sub>H<sub>18</sub>N<sub></sub>O |
|
| C = 6 | H = 6 | N = 6 | O = 6 |
|
|
| MolarMass = 258.15 g/mol |
|
| MolarMass = 156.25 g/mol |
|
|
| MeltingPt = 36–38 °C |
|
| Appearance = Yellow or brown powdered crystals (]) |
|
|
|
| BoilingPt = sublimes under vacuum |
|
| Density = 1.93 ]/cm<sup>3</sup> |
|
|
| MeltingPtC = 350 |
|
| Density = |
|
|
}} |
|
| BoilingPt = |
|
|
⚫ |
| Section8 = {{Chembox Hazards |
|
| Solubility = }} |
|
|
|
| ExternalMSDS = |
⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| RPhrases = {{R34}} |
|
|
| SPhrases = {{S26}} {{S36/37/39}} {{S45}} |
|
| FlashPt = |
|
|
| Autoignition = }} |
|
}} |
|
| Section6 = {{Chembox Explosive |
|
|
| ShockSens = Insensitive |
|
|
| FrictionSens = Insensitive |
|
|
| ExplosiveV = 7350 ] |
|
|
| REFactor = }} |
|
|
}} |
|
}} |