Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:45, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 455092156 of page Torasemide for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 13:45, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 457086516 of page Toremifene for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 414620633 | verifiedrevid = 416920150
| IUPAC_name = ''N''--4-pyridine-3-sulfonamide
| IUPAC_name = 2-{4-phenoxy}-''N,N''-dimethylethanamine
| image = Torasemide.svg
| image2 = Torasemide_bas.png | image = Toremifene.svg


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|international|torasemide}} | Drugs.com = {{drugs.com|monograph|fareston}}
| MedlinePlus = a601212 | MedlinePlus = a608003
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = C | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | legal_US = Rx-only
| pregnancy_category =
⚫ | routes_of_administration = Oral, ]
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
⚫ | legal_US = <!-- OTC / Rx-only -->
| legal_status =
⚫ | routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 80-90% | bioavailability =
| protein_bound = Highly bound (>99%). | protein_bound = more than 99.5%
| metabolism = Hepatic (80%) | metabolism =
| elimination_half-life = 3.5 hours; ]: 7-8 hours | elimination_half-life = 5 days
| excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 56211-40-6 | CAS_number = 89778-26-7
| ATC_prefix = C03
| ATC_suffix = CA04 | ATC_prefix = L02
| ATC_suffix = BA02
| ATC_supplemental = | ATC_supplemental =
| PubChem = 41781 | PubChem = 3005573
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00214 | DrugBank = DB00539
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 38123 | ChemSpiderID = 2275722
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W31X2H97FB | UNII = 7NFE54O27T
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00382 | KEGG = D08620
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 9635
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1148 | ChEMBL = 1655


<!--Chemical data--> <!--Chemical data-->
| C=16 | H=20 | N=4 | O=3 | S=1 | C=26 | H=28 | Cl=1 | N=1 | O=1
| molecular_weight = 348.421 g/mol | molecular_weight = 405.959 g/mol
| smiles = O=S(=O)(c2c(Nc1cc(ccc1)C)ccnc2)NC(=O)NC(C)C | smiles = ClCCC(/c1ccccc1)=C(/c2ccc(OCCN(C)C)cc2)c3ccccc3
| InChI = 1/C16H20N4O3S/c1-11(2)18-16(21)20-24(22,23)15-10-17-8-7-14(15)19-13-6-4-5-12(3)9-13/h4-11H,1-3H3,(H,17,19)(H2,18,20,21) | InChI = 1/C26H28ClNO/c1-28(2)19-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-18-27)21-9-5-3-6-10-21/h3-16H,17-20H2,1-2H3/b26-25-
| InChIKey = NGBFQHCMQULJNZ-UHFFFAOYAL | InChIKey = XFCLJVABOIYOMF-QPLCGJKRBL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20N4O3S/c1-11(2)18-16(21)20-24(22,23)15-10-17-8-7-14(15)19-13-6-4-5-12(3)9-13/h4-11H,1-3H3,(H,17,19)(H2,18,20,21) | StdInChI = 1S/C26H28ClNO/c1-28(2)19-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-18-27)21-9-5-3-6-10-21/h3-16H,17-20H2,1-2H3/b26-25-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NGBFQHCMQULJNZ-UHFFFAOYSA-N | StdInChIKey = XFCLJVABOIYOMF-QPLCGJKRSA-N
}} }}

Revision as of 13:45, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 457086516 of page Toremifene with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comMonograph
MedlinePlusa608003
ATC code
Pharmacokinetic data
Protein bindingmore than 99.5%
Elimination half-life5 days
Identifiers
IUPAC name
  • 2-{4-phenoxy}-N,N-dimethylethanamine
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC26H28ClNO
Molar mass405.959 g/mol g·mol
3D model (JSmol)
SMILES
  • ClCCC(/c1ccccc1)=C(/c2ccc(OCCN(C)C)cc2)c3ccccc3
InChI
  • InChI=1S/C26H28ClNO/c1-28(2)19-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-18-27)21-9-5-3-6-10-21/h3-16H,17-20H2,1-2H3/b26-25-
  • Key:XFCLJVABOIYOMF-QPLCGJKRSA-N
  (what is this?)  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic