Revision as of 14:09, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456598474 of page Trilostane for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'CAS_number').← Previous edit |
Revision as of 14:10, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 452560889 of page Trimeperidine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 447989848 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = (2S,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl propionate |
|
| Watchedfields = changed |
|
|
|
| image = 2D structure of Trimeperidine.svg |
⚫ |
| verifiedrevid = 402696562 |
|
|
|
| width = 160 |
|
| IUPAC_name = (4α,5α,17β)-3,17-dihydroxy-4,5-epoxyandrost-2-ene-2-carbonitrile |
|
|
| image = Trilostane.svg |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|tigan}} |
|
| Drugs.com = {{drugs.com|international|trimeperidine}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
⚫ |
| legal_UK = POM |
|
|
|
| legal_CA = <!-- Schedule I --> |
|
| legal_status = Veterinary use<small> (U.S.)</small> |
|
|
⚫ |
| legal_UK = <!-- Class A --> |
⚫ |
| routes_of_administration = oral |
|
|
|
| legal_US = <!-- Schedule I --> |
|
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
⚫ |
| metabolism = Hepatic |
|
|
|
| protein_bound = |
⚫ |
| elimination_half-life = 8 hours |
|
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 64-39-1 --> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| ATC_prefix = none |
⚫ |
| CAS_number = <!-- blanked - oldvalue: 13647-35-3 --> |
|
|
| ATC_prefix = H02 |
|
| ATC_suffix = |
|
| ATC_suffix = CA01 |
|
| PubChem = 6148 |
|
| PubChem = 656583 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01108 |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 570949 |
|
| ChemSpiderID = 16736164 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = L0FPV48Q5R |
|
| UNII = 1M2IB31DTS |
|
|
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
|
<!--Chemical data--> |
|
| KEGG = D01180 |
|
|
⚫ |
| C=17 | H=25 | N=1 | O=2 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
⚫ |
| molecular_weight = 275.39 g/mol |
|
| ChEBI = 32260 |
|
|
|
| smiles = C1CN(C)(C)C1(OC(=O)CC)c2ccccc2 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
| InChI = 1/C17H25NO2/c1-5-16(19)20-17(15-9-7-6-8-10-15)11-14(3)18(4)12-13(17)2/h6-10,13-14H,5,11-12H2,1-4H3/t13-,14+,17+/m1/s1 |
|
| ChEMBL = <!-- blanked - oldvalue: 1200907 --> |
|
|
|
| InChIKey = UVITTYOJFDLOGI-KEYYUXOJBX |
⚫ |
| C=20 | H=27 | N=1 | O=3 |
|
⚫ |
| molecular_weight = 329.433 g/mol |
|
|
| smiles = N#C\C4=C(/O)5O35(2(1((O)CC1)(C)CC2)CC3)(C)C4 |
|
|
| InChI = 1/C20H27NO3/c1-18-7-6-14-12(13(18)3-4-15(18)22)5-8-20-17(24-20)16(23)11(10-21)9-19(14,20)2/h12-15,17,22-23H,3-9H2,1-2H3/t12-,13-,14-,15-,17+,18-,19+,20+/m0/s1 |
|
|
| InChIKey = KVJXBPDAXMEYOA-CXANFOAXBX |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H27NO3/c1-18-7-6-14-12(13(18)3-4-15(18)22)5-8-20-17(24-20)16(23)11(10-21)9-19(14,20)2/h12-15,17,22-23H,3-9H2,1-2H3/t12-,13-,14-,15-,17+,18-,19+,20+/m0/s1 |
|
| StdInChI = 1S/C17H25NO2/c1-5-16(19)20-17(15-9-7-6-8-10-15)11-14(3)18(4)12-13(17)2/h6-10,13-14H,5,11-12H2,1-4H3/t13-,14+,17+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KVJXBPDAXMEYOA-CXANFOAXSA-N |
|
| StdInChIKey = UVITTYOJFDLOGI-KEYYUXOJSA-N |
|
|
| synonyms = Trimeperidine, Promadol |
|
}} |
|
}} |