| Revision as of 14:31, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{chembox}} taken from revid 449543325 of page Trolnitrate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 14:31, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{drugbox}} taken from revid 466409152 of page Tromantadine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 447427025 |
|
|
| IUPAC_name = ''N''-1-adamantyl-''N''-acetamide |
|
|
| image = Tromantadine.png |
|
|
| alt = Skeletal formula |
|
|
| image2 = Tromantadine-3D-balls.png |
|
|
| alt2 = Ball-and-stick model |
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|tromantadine}} |
|
|
| pregnancy_category = |
|
|
| legal_status = |
|
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| metabolism = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 53783-83-8 --> |
|
|
| ATC_prefix = D06 |
|
|
| ATC_suffix = BB02 |
|
⚫ |
| PubChem = 64377 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 57947 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = B9M85U075P |
|
| UNII = H191JFG8WA |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| verifiedrevid = 446141195 |
|
|
|
| KEGG = D07199 |
|
|ImageFile=Trolnitrate.png |
|
|
|
|
|
|ImageSize=200px |
|
|
|
<!--Chemical data--> |
|
|IUPACName=2-ethyl nitrate |
|
|
|
| C=16 | H=28 | N=2 | O=2 |
|
|OtherNames= |
|
|
|
| molecular_weight = 280.406 ]/] |
|
|Section1={{Chembox Identifiers |
|
|
|
| smiles = O=C(NC13CC2CC(CC(C1)C2)C3)COCCN(C)C |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 7077-34-1 --> |
|
|
|
| InChI = 1/C16H28N2O2/c1-18(2)3-4-20-11-15(19)17-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,3-11H2,1-2H3,(H,17,19) |
| ⚫ |
| PubChem=11499 |
|
|
|
| InChIKey = UXQDWARBDDDTKG-UHFFFAOYAP |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 11015 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H12N4O9/c11-8(12)17-4-1-7(2-5-18-9(13)14)3-6-19-10(15)16/h1-6H2 |
|
| StdInChI = 1S/C16H28N2O2/c1-18(2)3-4-20-11-15(19)17-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,3-11H2,1-2H3,(H,17,19) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HWKQNAWCHQMZHK-UHFFFAOYSA-N |
|
| StdInChIKey = UXQDWARBDDDTKG-UHFFFAOYSA-N |
|
| SMILES=C(CO(=O))N(CCO(=O))CCO(=O) |
|
|
| ATCCode_prefix = C01 |
|
|
| ATCCode_suffix = DA09 |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula=C<sub>6</sub>H<sub>12</sub>N<sub>4</sub>O<sub>9</sub> |
|
|
| MolarMass=284.18 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
