Revision as of 14:31, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 466409152 of page Tromantadine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 14:31, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 451493038 of page Tropane for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| verifiedrevid = 447427025 |
|
| verifiedrevid = 444238033 |
|
|
| Reference =<ref>''Merck Index'', 11th Edition, '''9689'''.</ref> |
|
| IUPAC_name = ''N''-1-adamantyl-''N''-acetamide |
|
|
| image = Tromantadine.png |
|
| ImageFileL1 = Tropane.png |
|
|
| ImageSizeL1 = 150px |
|
| alt = Skeletal formula |
|
|
| image2 = Tromantadine-3D-balls.png |
|
| ImageFileR1 = Tropane-3D-sticks.png |
|
|
| ImageSizeR1 = 150px |
|
| alt2 = Ball-and-stick model |
|
|
|
| IUPACName = N-Methyl-8-azabicyclooctane |
|
<!--Clinical data--> |
|
|
|
| OtherNames = 2,3-Dihydro-8-methylnortropidine |
|
| tradename = |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| Drugs.com = {{drugs.com|international|tromantadine}} |
|
|
|
| Abbreviations = |
|
| pregnancy_category = |
|
|
| legal_status = |
|
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| metabolism = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 53783-83-8 --> |
|
|
| ATC_prefix = D06 |
|
|
| ATC_suffix = BB02 |
|
⚫ |
| PubChem = 64377 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 57947 |
|
| ChemSpiderID = 553556 |
|
|
| InChI = 1S/C8H15N/c1-9-7-3-2-4-8(9)6-5-7/h7-8H,2-6H2,1H3/t7-,8+ |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| InChIKey = XLRPYZSEQKXZAA-OCAPTIKFBA |
|
| UNII = H191JFG8WA |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D07199 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=16 | H=28 | N=2 | O=2 |
|
|
| molecular_weight = 280.406 ]/] |
|
|
| smiles = O=C(NC13CC2CC(CC(C1)C2)C3)COCCN(C)C |
|
|
| InChI = 1/C16H28N2O2/c1-18(2)3-4-20-11-15(19)17-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,3-11H2,1-2H3,(H,17,19) |
|
|
| InChIKey = UXQDWARBDDDTKG-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H28N2O2/c1-18(2)3-4-20-11-15(19)17-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,3-11H2,1-2H3,(H,17,19) |
|
| StdInChI = 1S/C8H15N/c1-9-7-3-2-4-8(9)6-5-7/h7-8H,2-6H2,1H3/t7-,8+ |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UXQDWARBDDDTKG-UHFFFAOYSA-N |
|
| StdInChIKey = XLRPYZSEQKXZAA-OCAPTIKFSA-N |
|
|
| InChIKey1 = XLRPYZSEQKXZAA-OCAPTIKFSA-N |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 529-17-9 --> |
|
|
| EINECS = |
|
⚫ |
| PubChem = 637986 |
|
|
| SMILES = N1(C)2CC1CCC2 |
|
|
| InChI = |
|
|
| RTECS = |
|
|
| MeSHName = |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 35615 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = |
|
|
| ATCCode_prefix = |
|
|
| ATCCode_suffix = |
|
|
| ATC_Supplemental =}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>8</sub>H<sub>15</sub>N |
|
|
| MolarMass = 125.211 g/mol |
|
|
| Appearance = |
|
|
| Density = 0.9259 at 15 °C |
|
|
| MeltingPt = |
|
|
| Melting_notes = |
|
|
| BoilingPt = 163-169 °C |
|
|
| Boiling_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb = }} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
}} |
|
}} |