Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 17:16, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 415301524 of page 2-Chloro-9,10-diphenylanthracene for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 17:16, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 432746784 of page 2-Chloro-m-cresol for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Chembox
| verifiedrevid = 399296473 | verifiedrevid = 399296574
| Name = 2-chloro-9,10-diphenyl-anthracene |Name=2-Chloro-''m''-cresol
| ImageFile = 2-chloro-9,10-diphenylanthracene.png |ImageFile=2-chloro-m-cresol.png
| ImageSize = 150px |ImageSize=120px
|IUPACName=2-chloro-3-methyl-phenol
| ImageAlt =
|OtherNames= 2-Chloro-hydroxytoluene; 2-Chloro-m-cresol
| ImageName =
|Section1= {{Chembox Identifiers
| IUPACName = 2-Chloro-9,10-diphenyl-anthracene
| InChIKey = HKHXLHGVIHQKMK-UHFFFAOYAK
| OtherNames =
| Section1 = {{Chembox Identifiers
| Abbreviations =
| InChIKey = PLMFIWDPKYXMGE-UHFFFAOYAZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C26H17Cl/c27-20-15-16-23-24(17-20)26(19-11-5-2-6-12-19)22-14-8-7-13-21(22)25(23)18-9-3-1-4-10-18/h1-17H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PLMFIWDPKYXMGE-UHFFFAOYSA-N | StdInChIKey = HKHXLHGVIHQKMK-UHFFFAOYSA-N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| CASNo =
| ChemSpiderID = 14162
| CASNo_Ref =
| InChI = 1/C7H7ClO/c1-5-3-2-4-6(9)7(5)8/h2-4,9H,1H3
| CASNos =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| CASOther =
| StdInChI = 1S/C7H7ClO/c1-5-3-2-4-6(9)7(5)8/h2-4,9H,1H3
| PubChem =
| SMILES=Clc1c(cccc1O)C
| EINECS =
| EC-number = | MeSHName=
}}
| EINECSCASNO =
|Section2= {{Chembox Properties
| UNNumber =
| Formula=C<sub>7</sub>H<sub>7</sub>ClO
| DrugBank =
| MolarMass =142.5829
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = | Appearance=
| Density= 1.228 g/cm<sup>3</sup>
| MeSHName =
| ChEBI = | MeltingPt =
| RTECS = | BoilingPt =
}}
| ATCvet =
|Section3= {{Chembox Hazards
| ATCCode_prefix =
| FlashPt=78.1 °C
| ATCCode_suffix =
}}
| ATC_Supplemental =
| SMILES = Clc4ccc3c(c1ccccc1c(c2ccccc2)c3c4)c5ccccc5
| InChI = 1/C26H17Cl/c27-20-15-16-23-24(17-20)26(19-11-5-2-6-12-19)22-14-8-7-13-21(22)25(23)18-9-3-1-4-10-18/h1-17H
| Beilstein =
| Gmelin =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID =549193
| 3DMet =}}
| Section2 = {{Chembox Properties
| C=26 | H=17 | Cl=1 |
| Appearance =
| Density =
| MeltingPt =
| Melting_notes =
| BoilingPt =
| Boiling_notes =
| Solubility =
| SolubleOther =
| Solvent =
| LogP =
| VaporPressure =
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb = }}
| Section3 = {{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape = }}
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = }}
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
| Section6 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| ExplosiveV =
| REFactor = }}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| LD50 =
| PEL = }}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = }}
}} }}

Revision as of 17:16, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 432746784 of page 2-Chloro-m-cresol with values updated to verified values.
2-Chloro-m-cresol
Names
IUPAC name 2-chloro-3-methyl-phenol
Other names 2-Chloro-hydroxytoluene; 2-Chloro-m-cresol
Identifiers
3D model (JSmol)
ChemSpider
InChI
  • InChI=1S/C7H7ClO/c1-5-3-2-4-6(9)7(5)8/h2-4,9H,1H3Key: HKHXLHGVIHQKMK-UHFFFAOYSA-N
  • InChI=1/C7H7ClO/c1-5-3-2-4-6(9)7(5)8/h2-4,9H,1H3Key: HKHXLHGVIHQKMK-UHFFFAOYAK
SMILES
  • Clc1c(cccc1O)C
Properties
Chemical formula C7H7ClO
Molar mass 142.5829
Density 1.228 g/cm
Hazards
Flash point 78.1 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic