Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 20:02, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 474663576 of page Acridine_orange for the Chem/Drugbox validation project (updated: 'ChEBI', 'KEGG', 'CASNo').← Previous edit Revision as of 20:02, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 457804281 of page Acridine_yellow for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'StdInChI', 'StdInChIKey', 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 457803101 | verifiedrevid = 457803194
| ImageFile = Acridine Orange.png | ImageFile = Acridine yellow.png
| IUPACName = 2,7-Dimethylacridine-3,6-diamine
| ImageName = Acridine orange
⚫ | OtherNames = 2,7-Dimethylproflavine<br />
| PIN = ''N'',''N'',''N<nowiki>'</nowiki>'',''N<nowiki>'</nowiki>''-Tetramethylacridine-3,6-diamine
⚫ Acridine yellow G<br />
| SystematicName = 3-''N'',3-''N'',6-''N'',6-''N''-Tetramethylacridine-3,6-diamine
⚫ Acridine yellow H107<br />
⚫ | OtherNames = 3,6-Acridinediamine<br />
Basic Yellow K
⚫ Acridine Orange Base<br />
⚫ Acridine Orange NO<br />
Basic Orange 14<br />
Euchrysine<br />
Rhoduline Orange<br />
Rhoduline Orange N<br />
Rhoduline Orange NO<br />
Solvent Orange 15<br />
Waxoline Orange A
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 81880 | ChEMBL = <!-- blanked - oldvalue: 329221 -->
| StdInChI1 = 1/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1H
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey1 = BGLGAKMTYHWWKW-UHFFFAOYAJ
| StdInChI = 1S/C17H19N3/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14/h5-11H,1-4H3
| SMILES1 = Cl.n1c3c(cc2c1cc(N)c(c2)C)cc(c(c3)N)C
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1H
⚫ | StdInChIKey = DPKHZNPWBDQZCN-UHFFFAOYSA-N
| InChIKey = BGLGAKMTYHWWKW-UHFFFAOYSA-N
| InChI1 = 1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1H
| InChIKey1 = BGLGAKMTYHWWKW-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}} | CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 494-38-2 --> | CASNo = <!-- blanked - oldvalue: 92-26-2 -->
| PubChem = 62344 | PubChem = 8672
| PubChem_Ref = {{Pubchemcite}} | PubChem_Ref = {{Pubchemcite}}
| ChemSpiderID = 56136 | ChemSpiderID = 8348
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 200-614-0 | EINECS = 202-141-5
| MeSHName = Acridine+orange | MeSHName = Acridine+yellow
| ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = <!-- blanked - oldvalue: 234241 --> | ChEBI = 51742
| RTECS = AR7601000 | RTECS = AR8790000
| SMILES = n1c3c(cc2c1cc(N(C)C)cc2)ccc(c3)N(C)C | SMILES = CC1=CC2=CC3=C(C=C(N)C(C)=C3)N=C2C=C1N
⚫ | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| InChI = 1/C17H19N3/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14/h5-11H,1-4H3
| StdInChI = 1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1H
| InChIKey = DPKHZNPWBDQZCN-UHFFFAOYAJ
| KEGG_Ref = {{keggcite|changed|kegg}} | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
⚫ | StdInChIKey = BGLGAKMTYHWWKW-UHFFFAOYSA-N
| KEGG = <!-- blanked - oldvalue: C19315 -->
| Beilstein = 5-22-11-0​0340}}
⚫ | Section2={{Chembox Properties|
| Formula = C<sub>15</sub>H<sub>15</sub>N<sub>3</sub>
| MolarMass = 273.30 g/mol
⚫ | Appearance = Brown/red crystals
| Density =
| Solubility =
| MeltingPt =
| BoilingPt =
| pKa =
| pKb =
| IsoelectricPt =
| DeltaHf =
| DeltaHc =
}} }}
⚫ | Section2 = {{Chembox Properties
|C=17|H=19|N=3|
⚫ | Appearance = Orange powder
}}
| Section7 = {{Chembox Hazards | Section7 = {{Chembox Hazards
| EUClass = {{Hazchem_Xi}} {{Hazchem_N}} | EUClass = Harmful (XN)
| NFPA-H = 2 | MainHazards =
| NFPA-F = 0 | NFPA-H = 2
| NFPA-R = 0 | NFPA-F = 1
| NFPA-R = 0
⚫ | SPhrases = {{S26}} {{S28}} {{S37}} {{S45}}
| RPhrases = {{R20/21/22}}, {{R36/37/38}}, {{R68}}
}}
⚫ | SPhrases = {{S26}}, {{S36/37/39}}
| RSPhrases = R:{{R1}}, {{R2}}<br/>S:{{S1}}, {{S2}}
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL =}}
}} }}

Revision as of 20:02, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 457804281 of page Acridine_yellow with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name 2,7-Dimethylacridine-3,6-diamine
Other names 2,7-Dimethylproflavine

Acridine yellow G
Acridine yellow H107

Basic Yellow K
Identifiers
3D model (JSmol)
Beilstein Reference 5-22-11-0​0340
ChEBI
ChemSpider
EC Number
  • 202-141-5
MeSH Acridine+yellow
PubChem CID
RTECS number
  • AR8790000
InChI
  • InChI=1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1HKey: BGLGAKMTYHWWKW-UHFFFAOYSA-N
  • InChI=1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1HKey: BGLGAKMTYHWWKW-UHFFFAOYSA-N
  • InChI=1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1HKey: BGLGAKMTYHWWKW-UHFFFAOYSA-N
SMILES
  • CC1=CC2=CC3=C(C=C(N)C(C)=C3)N=C2C=C1N
  • Cl.n1c3c(cc2c1cc(N)c(c2)C)cc(c(c3)N)C
Properties
Chemical formula C15H15N3
Molar mass 273.30 g/mol
Appearance Brown/red crystals
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 2: Intense or continued but not chronic exposure could cause temporary incapacitation or possible residual injury. E.g. chloroformFlammability 1: Must be pre-heated before ignition can occur. Flash point over 93 °C (200 °F). E.g. canola oilInstability 0: Normally stable, even under fire exposure conditions, and is not reactive with water. E.g. liquid nitrogenSpecial hazards (white): no code
2 1 0
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic