| Revision as of 14:28, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 477353218 of page Bacillosamine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 14:29, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 477353269 of page Balofloxacin for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 460422250 |
|
| verifiedrevid = 461211442 |
|
|
| IUPAC_name = 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylaminopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
|
| ImageFile = Bacillosamine.png |
|
|
|
| image = Balofloxacin.png |
|
| ImageSize = 200px |
|
|
|
|
|
| IUPACName = (2''R'',3''S'',4''R'',5''R'')-2,4-Diamino-3,5-dihydroxyhexanal |
|
|
|
<!--Clinical data--> |
|
| OtherNames = 4-Deoxyneosamine C<br>2,4-Diamino-2,4,6-trideoxy-<small>D</small>-Glucose |
|
|
|
| tradename = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| Abbreviations = |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
|
|
| pregnancy_category = |
|
| CASNo = <!-- blanked - oldvalue: 7013-45-8 --> |
|
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| EINECS = |
|
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| PubChem = 192835 |
|
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 127294-70-6 --> |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
|
| ATC_supplemental = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1210954 |
|
|
| PubChem = 65958 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = Q022B63JPM |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 167348 |
|
| ChemSpiderID = 59361 |
|
|
| InChI = 1/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27) |
|
| SMILES = O=C(N)(O)(N)(O)C |
|
|
|
| InChIKey = MGQLHRYJBWGORO-UHFFFAOYAR |
|
| InChI = 1/C6H14N2O3/c1-3(10)5(8)6(11)4(7)2-9/h2-6,10-11H,7-8H2,1H3/t3-,4+,5-,6-/m1/s1 |
|
|
| InChIKey = UOKKJQVOZSYEJM-JGWLITMVBO |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H14N2O3/c1-3(10)5(8)6(11)4(7)2-9/h2-6,10-11H,7-8H2,1H3/t3-,4+,5-,6-/m1/s1 |
|
| StdInChI = 1S/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UOKKJQVOZSYEJM-JGWLITMVSA-N |
|
| StdInChIKey = MGQLHRYJBWGORO-UHFFFAOYSA-N |
|
|
|
|
| RTECS = |
|
|
|
<!--Chemical data--> |
|
| MeSHName = |
|
|
|
| chemical_formula = |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
|
| C=20 | H=24 | F=1 | N=3 | O=4 |
|
| ChEBI = 32538 |
|
|
|
| molecular_weight = 389.42 g/mol |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
|
| smiles = CNC1CCCN(C1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F |
|
| KEGG = |
|
|
| ATCCode_prefix = |
|
|
| ATCCode_suffix = |
|
|
| ATC_Supplemental =}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>6</sub>H<sub>14</sub>N<sub>2</sub>O<sub>3</sub> |
|
|
| MolarMass = 162.19 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| Melting_notes = |
|
|
| BoilingPt = |
|
|
| Boiling_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb = |
|
|
| IsoelectricPt = |
|
|
| LambdaMax = |
|
|
| Absorbance = |
|
|
| SpecRotation = |
|
|
| RefractIndex = |
|
|
| Viscosity = |
|
|
| Dipole = }} |
|
|
| Section3 = {{Chembox Structure |
|
|
| CrystalStruct = |
|
|
| Coordination = |
|
|
| MolShape = }} |
|
|
| Section4 = {{Chembox Thermochemistry |
|
|
| DeltaHf = |
|
|
| DeltaHc = |
|
|
| Entropy = |
|
|
| HeatCapacity = }} |
|
|
| Section5 = {{Chembox Pharmacology |
|
|
| AdminRoutes = |
|
|
| Bioavail = |
|
|
| Metabolism = |
|
|
| HalfLife = |
|
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| PregCat = |
|
|
| PregCat_AU = |
|
|
| PregCat_US = }} |
|
|
| Section6 = {{Chembox Explosive |
|
|
| ShockSens = |
|
|
| FrictionSens = |
|
|
| ExplosiveV = |
|
|
| REFactor = }} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = |
|
|
| OtherCations = |
|
|
| OtherFunctn = |
|
|
| Function = |
|
|
| OtherCpds = }} |
|
|
}} |
|
}} |
