Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:40, 9 April 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 486424472 of page Fluconazole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 13:52, 9 April 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 476476211 of page Galanin for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 456485284 | verifiedrevid = 403760667
| IUPAC_name =
| IUPAC_name = 2-(2,4-difluorophenyl)-<br />1,3-''bis''(1''H''-1,2,4-triazol-1-yl)propan-2-ol
| image = fluconazole_structure.svg | image =
| width = 160 | alt =
| image2 = Fluconazole-from-xtal-3D-balls.png


<!--Clinical data--> <!--Clinical data-->
| tradename = Difulcan | tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| Drugs.com = {{drugs.com|monograph|fluconazole}}
| pregnancy_US = <!-- A / B / C / D / X -->
| MedlinePlus = a690002
| pregnancy_category = D <small>(])</small>, C <small>(])</small> | pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_status = S3/S4 <small>(Au)</small>, POM <small>(])</small>, ℞-only <small>(U.S.)</small>
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| routes_of_administration = Oral, ], topical
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = >90% | bioavailability =
| protein_bound = 11–12% | protein_bound =
| metabolism = Hepatic 11% | metabolism =
| elimination_half-life = 30 hours (range 20-50 hours) | elimination_half-life =
| excretion = Renal 61–88% | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 86386-73-4 | CAS_number =
| ATC_prefix = D01 | ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix = AC15 | ATC_suffix =
| ATC_supplemental = {{ATC|J02|AC01}}
| PubChem = 3365 | PubChem =
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00196 | DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3248
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8VZV102JFY
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00322
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 46081
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 106 | ChEMBL = <!-- blanked - oldvalue: 501079 -->
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = NA


<!--Chemical data--> <!--Chemical data-->
| chemical_formula = C146 H213 N43 O40
| C=13 | H=12 | F=2 | N=6 | O=1

| molecular_weight = 306.271 g/mol | molecular_weight = 3210.5
| smiles = Fc1ccc(c(F)c1)C(O)(Cn2ncnc2)Cn3ncnc3
| InChI = 1/C13H12F2N6O/c14-10-1-2-11(12(15)3-10)13(22,4-20-8-16-6-18-20)5-21-9-17-7-19-21/h1-3,6-9,22H,4-5H2
| InChIKey = RFHAOTPXVQNOHP-UHFFFAOYAZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H12F2N6O/c14-10-1-2-11(12(15)3-10)13(22,4-20-8-16-6-18-20)5-21-9-17-7-19-21/h1-3,6-9,22H,4-5H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RFHAOTPXVQNOHP-UHFFFAOYSA-N
}} }}

Revision as of 13:52, 9 April 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 476476211 of page Galanin with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Identifiers
ChemSpider
Chemical and physical data
FormulaC146 H213 N43 O40
Molar mass3210.5
  (what is this?)  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic