This is an old revision of this page, as edited by Beetstra (talk | contribs) at 13:44, 22 November 2011 (Saving copy of the {{drugbox}} taken from revid 451181814 of page Ibutilide for the Chem/Drugbox validation project (updated: 'DrugBank').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.
Revision as of 13:44, 22 November 2011 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 451181814 of page Ibutilide for the Chem/Drugbox validation project (updated: 'DrugBank').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)This page contains a copy of the infobox ({{drugbox}}) taken from revid 451181814 of page Ibutilide with values updated to verified values. |
{{Drugbox | verifiedrevid = 407854380 | IUPAC_name = N-(4-{4--1-hydroxybutyl}phenyl)methanesulfonamide | image = Ibutilide.svg | width = 250
| tradename = Corvert | Drugs.com = Monograph | MedlinePlus = a601248 | pregnancy_AU = | pregnancy_US = | pregnancy_category = C | legal_AU = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Intravenous
| bioavailability = N/A | protein_bound = 40% | metabolism = Hepatic oxidation | elimination_half-life = 6 hours (2-12 hours) | excretion = Renal (82%), fecal
| CASNo_Ref = | CAS_number = 122647-32-9 | ATC_prefix = C01 | ATC_suffix = BD05 | ATC_supplemental = | PubChem = 60753 | DrugBank_Ref = | DrugBank = DB00308 | ChemSpiderID_Ref = | ChemSpiderID = 54755 | UNII_Ref = | UNII = 9L5X4M5L6I | KEGG_Ref = | KEGG = D00648 | ChEMBL_Ref = | ChEMBL = 533
| C=20 | H=36 | N=2 | O=3 | S=1 | molecular_weight = 384.578 g/mol | smiles = O=S(=O)(Nc1ccc(cc1)C(O)CCCN(CC)CCCCCCC)C | InChI = 1/C20H36N2O3S/c1-4-6-7-8-9-16-22(5-2)17-10-11-20(23)18-12-14-19(15-13-18)21-26(3,24)25/h12-15,20-21,23H,4-11,16-17H2,1-3H3 | InChIKey = ALOBUEHUHMBRLE-UHFFFAOYAM | StdInChI_Ref = | StdInChI = 1S/C20H36N2O3S/c1-4-6-7-8-9-16-22(5-2)17-10-11-20(23)18-12-14-19(15-13-18)21-26(3,24)25/h12-15,20-21,23H,4-11,16-17H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = ALOBUEHUHMBRLE-UHFFFAOYSA-N }}