This is an old revision of this page, as edited by Beetstra (talk | contribs) at 19:48, 16 February 2012 (Saving copy of the {{drugbox}} taken from revid 447576927 of page Aceprometazine for the Chem/Drugbox validation project (updated: '').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.
Revision as of 19:48, 16 February 2012 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 447576927 of page Aceprometazine for the Chem/Drugbox validation project (updated: '').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)This page contains a copy of the infobox ({{drugbox}}) taken from revid 447576927 of page Aceprometazine with values updated to verified values. |
{{Drugbox | verifiedrevid = 443364752 | IUPAC_name = 1-{10--10H-phenothiazin-2-yl}ethanone | image = Aceprometazine.svg
| tradename =
| pregnancy_category = Contraindicated
Passes into breast milk
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability = | protein_bound = | metabolism = Hepatic | elimination_half-life = | excretion = Renal and fecal
| CASNo_Ref = | CAS_number = 13461-01-3 | ATC_prefix = none | ATC_suffix = | PubChem = 26035 | DrugBank_Ref = | DrugBank = DB01615 | ChemSpiderID_Ref = | ChemSpiderID = 24249 | UNII_Ref = | UNII = 984N9YTM4Y | ChEBI_Ref = | ChEBI = 53770
| C=19 | H=22 | N=2 | O=1 | S=1 | molecular_weight = 326.456 g/mol | smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CC(N(C)C)C)C | InChI = 1/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 | InChIKey = XLOQNFNTQIRSOX-UHFFFAOYAZ | StdInChI_Ref = | StdInChI = 1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 | StdInChIKey_Ref = | StdInChIKey = XLOQNFNTQIRSOX-UHFFFAOYSA-N }}