Misplaced Pages

1,2-Bis(diisopropylphosphino)ethane: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 22:16, 5 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbox validati← Previous edit Latest revision as of 02:17, 3 July 2024 edit undoLeiem (talk | contribs)Extended confirmed users, IP block exemptions2,308 edits added Category:1,2-Ethanediyl compounds using HotCat 
(11 intermediate revisions by 10 users not shown)
Line 1: Line 1:
{{Redirect|Dippe|the American film director|Mark A.Z. Dippé}}
{{Chembox {{Chembox
| verifiedrevid = 443252112 | verifiedrevid = 443253354
| ImageFile = Dippe.PNG | ImageFile = 1,2-Bis(diisopropylphosphino)ethane-2D-by-AHRLS-2012.png
| ImageSize = | ImageSize = 140
| ImageFile2 = 1,2-Bis(diisopropylphosphino)ethane-3D-balls-by-AHRLS-2012.png
| ImageAlt =
| ImageSize2 = 140
| IUPACName = 1,2-Ethanediylbis | PIN = (Ethane-1,2-diyl)bis
| OtherNames = dippe | OtherNames = dippe
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 87532-69-2 | CASNo = 87532-69-2
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 533625 | PubChem = 533625
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RMFRFTSSEHRKKW-UHFFFAOYSA-N | StdInChIKey = RMFRFTSSEHRKKW-UHFFFAOYSA-N
| ChemSpiderID = 464926 | ChemSpiderID = 464926
| SMILES = P(C(C)C)(CCP(C(C)C)C(C)C)C(C)C | SMILES = P(C(C)C)(CCP(C(C)C)C(C)C)C(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H32P2/c1-11(2)15(12(3)4)9-10-16(13(5)6)14(7)8/h11-14H,9-10H2,1-8H3 | StdInChI = 1S/C14H32P2/c1-11(2)15(12(3)4)9-10-16(13(5)6)14(7)8/h11-14H,9-10H2,1-8H3
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C = 14 | H = 32 | P = 2 | C=14 | H=32 | P=2
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility = }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt = }}
}} }}


Line 34: Line 36:


{{DEFAULTSORT:Bis(diisopropylphosphino)ethane, 1,2-}} {{DEFAULTSORT:Bis(diisopropylphosphino)ethane, 1,2-}}
] ]
]

] ]
1,2-Bis(diisopropylphosphino)ethane: Difference between revisions Add topic